EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O2 |
| Net Charge | 0 |
| Average Mass | 60.052 |
| Monoisotopic Mass | 60.02113 |
| SMILES | CC(=O)O |
| InChI | InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) |
| InChIKey | QTBSBXVTEAMEQO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | PubMed (20117838) |
| Roles Classification |
|---|
| Chemical Roles: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| Applications: | food acidity regulator A food additive that is used to change or otherwise control the acidity or alkalinity of foods. They may be acids, bases, neutralising agents or buffering agents. protic solvent A polar solvent that is capable of acting as a hydron (proton) donor. antimicrobial food preservative A food preservative which prevents decomposition of food by preventing the growth of fungi or bacteria. In European countries, E-numbers for permitted food preservatives are from E200 to E299, divided into sorbates (E200-209), benzoates (E210-219), sulfites (E220-229), phenols and formates (E230-239), nitrates (E240-259), acetates (E260-269), lactates (E270-279), propionates (E280-289) and others (E290-299). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetic acid (CHEBI:15366) has role Daphnia magna metabolite (CHEBI:83056) |
| acetic acid (CHEBI:15366) has role antimicrobial food preservative (CHEBI:65256) |
| acetic acid (CHEBI:15366) has role food acidity regulator (CHEBI:64049) |
| acetic acid (CHEBI:15366) has role protic solvent (CHEBI:48356) |
| acetic acid (CHEBI:15366) is a monocarboxylic acid (CHEBI:25384) |
| acetic acid (CHEBI:15366) is conjugate acid of acetate (CHEBI:30089) |
| Incoming Relation(s) |
| (1-hydroxycyclohexyl)acetic acid (CHEBI:37276) has functional parent acetic acid (CHEBI:15366) |
| (2-hydroxyphenyl)acetic acid (CHEBI:28478) has functional parent acetic acid (CHEBI:15366) |
| (2,2,2-trifluoroethoxy)acetic acid (CHEBI:60702) has functional parent acetic acid (CHEBI:15366) |
| (2,2,3-trimethyl-5-oxocyclopent-3-en-1-yl)acetic acid (CHEBI:28045) has functional parent acetic acid (CHEBI:15366) |
| (2,6-dihydroxyphenyl)acetic acid (CHEBI:952) has functional parent acetic acid (CHEBI:15366) |
| (2S)-({(5Z)-5-[(5-ethylfuran-2-yl)methylidene]-4-oxo-4,5-dihydro-1,3-thiazol-2-yl}amino)(4-fluorophenyl)acetic acid (CHEBI:46520) has functional parent acetic acid (CHEBI:15366) |
| (2S)-[(2S,3S,4S,5S)-1,3,4,5-tetrahydroxy-4-(hydroxymethyl)piperidin-2-yl](L-tyrosylamino)acetic acid (CHEBI:40208) has functional parent acetic acid (CHEBI:15366) |
| (3-{(1R)-3-(3,4-dimethoxyphenyl)-1-[({(2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidin-2-yl}carbonyl)oxy]propyl}phenoxy)acetic acid (CHEBI:40833) has functional parent acetic acid (CHEBI:15366) |
| (3-amino-2,5-dioxopyrrolidin-1-yl)acetic acid (CHEBI:45890) has functional parent acetic acid (CHEBI:15366) |
| (3-chloro-4-hydroxyphenyl)acetic acid (CHEBI:47106) has functional parent acetic acid (CHEBI:15366) |
| (3Z)-hex-3-en-1-yl acetate (CHEBI:61316) has functional parent acetic acid (CHEBI:15366) |
| (4-oxo-3-{[5-(trifluoromethyl)-1,3-benzothiazol-2-yl]methyl}-3,4-dihydrophthalazin-1-yl)acetic acid (CHEBI:46609) has functional parent acetic acid (CHEBI:15366) |
| (5-fluoro-2-{[(4,5,7-trifluoro-1,3-benzothiazol-2-yl)methyl]carbamoyl}phenoxy)acetic acid (CHEBI:43373) has functional parent acetic acid (CHEBI:15366) |
| [(1S)-4-hydroxy-2,2,3-trimethylcyclopent-3-enyl]acetic acid (CHEBI:64899) has functional parent acetic acid (CHEBI:15366) |
| [(2S,4S)-2-[(1R)-1-amino-2-hydroxyethyl]-4-(1H-imidazol-4-ylmethyl)-5-oxoimidazolidin-1-yl]acetic acid (CHEBI:41707) has functional parent acetic acid (CHEBI:15366) |
| [(2S,4S)-2-[(1R)-1-amino-2-hydroxyethyl]-4-(4-hydroxybenzyl)-5-oxoimidazolidin-1-yl]acetic acid (CHEBI:41749) has functional parent acetic acid (CHEBI:15366) |
| [(2S,4S)-2-[(1R)-1-amino-2-sulfanylethyl]-4-(4-hydroxybenzyl)-5-oxoimidazolidin-1-yl]acetic acid (CHEBI:41383) has functional parent acetic acid (CHEBI:15366) |
| [5-fluoro-1-(4-isopropylbenzylidene)-2-methylinden-3-yl]acetic acid (CHEBI:59660) has functional parent acetic acid (CHEBI:15366) |
| {(2R)-2-[(1S,2R)-1-amino-2-hydroxypropyl]-2-hydroxy-4,5-dioxoimidazolidin-1-yl}acetic acid (CHEBI:41360) has functional parent acetic acid (CHEBI:15366) |
| {(2R)-2-[(1S)-1-aminoethyl]-2-hydroxy-4-methylidene-5-oxoimidazolidin-1-yl}acetic acid (CHEBI:41608) has functional parent acetic acid (CHEBI:15366) |
| {[5-(3-{[1-(benzylsulfonyl)piperidin-4-yl]amino}phenyl)-4-bromo-2-(2H-tetrazol-5-yl)thiophen-3-yl]oxy}acetic acid (CHEBI:47182) has functional parent acetic acid (CHEBI:15366) |
| {[5-(5-nitro-2-furyl)-1,3,4-oxadiazol-2-yl]thio}acetic acid (CHEBI:43741) has functional parent acetic acid (CHEBI:15366) |
| {4-[(carboxymethoxy)carbonyl]-3,3-dioxido-1-oxonaphtho[1,2-d]-1,2-thiazol-2(1H)-yl}acetic acid (CHEBI:43485) has functional parent acetic acid (CHEBI:15366) |
| N-acetyl-amino acid (CHEBI:21575) has functional parent acetic acid (CHEBI:15366) |
| N-phenylacetamide (CHEBI:28884) has functional parent acetic acid (CHEBI:15366) |
| O-acetylcarnitine (CHEBI:73024) has functional parent acetic acid (CHEBI:15366) |
| 1-O-palmityl-2-acetyl-sn-glycerol (CHEBI:75936) has functional parent acetic acid (CHEBI:15366) |
| 1-alkyl-2-acetylglycerol (CHEBI:75882) has functional parent acetic acid (CHEBI:15366) |
| 1-hexadecyl-2-acetyl-sn-glycero-3-phosphoethanolamine (CHEBI:79280) has functional parent acetic acid (CHEBI:15366) |
| 1-methyl-4-imidazoleacetic acid (CHEBI:1606) has functional parent acetic acid (CHEBI:15366) |
| 1-palmitoyl-2-acetyl-sn-glycero-3-phosphocholine (CHEBI:75219) has functional parent acetic acid (CHEBI:15366) |
| 1-palmityl-2-acetyl-sn-glycero-3-phosphate (CHEBI:79277) has functional parent acetic acid (CHEBI:15366) |
| 1-stearoyl-2-acetyl-sn-glycero-3-phosphocholine (CHEBI:75220) has functional parent acetic acid (CHEBI:15366) |
| 2-acetyl-sn-glycero-3-phosphocholine (CHEBI:78045) has functional parent acetic acid (CHEBI:15366) |
| 2-thienylacetic acid (CHEBI:45807) has functional parent acetic acid (CHEBI:15366) |
| 2H-imidazol-4-ylacetic acid (CHEBI:43615) has functional parent acetic acid (CHEBI:15366) |
| 3-hydroxyphenylacetic acid (CHEBI:17445) has functional parent acetic acid (CHEBI:15366) |
| 3-methylphenylacetic acid (CHEBI:88356) has functional parent acetic acid (CHEBI:15366) |
| 4-chlorophenylacetic acid (CHEBI:30749) has functional parent acetic acid (CHEBI:15366) |
| 4-hydroxyphenylacetic acid (CHEBI:18101) has functional parent acetic acid (CHEBI:15366) |
| 6-{[1-(benzylsulfonyl)piperidin-4-yl]amino}-3-(carboxymethoxy)thieno[3,2-b][1]benzothiophene-2-carboxylic acid (CHEBI:40145) has functional parent acetic acid (CHEBI:15366) |
| acetamidine (CHEBI:38478) has functional parent acetic acid (CHEBI:15366) |
| acetate ester (CHEBI:47622) has functional parent acetic acid (CHEBI:15366) |
| acetimidic acid (CHEBI:49028) has functional parent acetic acid (CHEBI:15366) |
| acetyl chloride (CHEBI:37580) has functional parent acetic acid (CHEBI:15366) |
| acetyl-CoA (CHEBI:15351) has functional parent acetic acid (CHEBI:15366) |
| arsenoacetic acid (CHEBI:22634) has functional parent acetic acid (CHEBI:15366) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has functional parent acetic acid (CHEBI:15366) |
| bis(4-chlorophenyl)acetic acid (CHEBI:28139) has functional parent acetic acid (CHEBI:15366) |
| chloroacetic acid (CHEBI:27869) has functional parent acetic acid (CHEBI:15366) |
| cyanoacetic acid (CHEBI:51889) has functional parent acetic acid (CHEBI:15366) |
| cyclohexylacetic acid (CHEBI:37277) has functional parent acetic acid (CHEBI:15366) |
| dibromoacetic acid (CHEBI:90124) has functional parent acetic acid (CHEBI:15366) |
| dichloroacetic acid (CHEBI:36386) has functional parent acetic acid (CHEBI:15366) |
| diflorasone diacetate (CHEBI:31483) has functional parent acetic acid (CHEBI:15366) |
| difluoroacetic acid (CHEBI:23716) has functional parent acetic acid (CHEBI:15366) |
| diphenylacetic acid (CHEBI:41967) has functional parent acetic acid (CHEBI:15366) |
| etacrynic acid (CHEBI:4876) has functional parent acetic acid (CHEBI:15366) |
| glycolic acid (CHEBI:17497) has functional parent acetic acid (CHEBI:15366) |
| haloacetic acid (CHEBI:16277) has functional parent acetic acid (CHEBI:15366) |
| hydroxy(phenyl)2-thienylacetic acid (CHEBI:64444) has functional parent acetic acid (CHEBI:15366) |
| ibufenac (CHEBI:76158) has functional parent acetic acid (CHEBI:15366) |
| imidazol-1-ylacetic acid (CHEBI:70801) has functional parent acetic acid (CHEBI:15366) |
| imidazol-2-ylacetic acid (CHEBI:70806) has functional parent acetic acid (CHEBI:15366) |
| imidazol-4-ylacetic acid (CHEBI:16974) has functional parent acetic acid (CHEBI:15366) |
| imidazol-5-ylacetic acid (CHEBI:70804) has functional parent acetic acid (CHEBI:15366) |
| indole-1-acetic acid (CHEBI:72814) has functional parent acetic acid (CHEBI:15366) |
| indole-3-acetic acids (CHEBI:24803) has functional parent acetic acid (CHEBI:15366) |
| lonazolac (CHEBI:76164) has functional parent acetic acid (CHEBI:15366) |
| magnesium acetate (CHEBI:62964) has functional parent acetic acid (CHEBI:15366) |
| mandelic acid (CHEBI:35825) has functional parent acetic acid (CHEBI:15366) |
| methoxyacetic acid (CHEBI:132098) has functional parent acetic acid (CHEBI:15366) |
| naphthylacetic acid (CHEBI:35629) has functional parent acetic acid (CHEBI:15366) |
| peracetic acid (CHEBI:42530) has functional parent acetic acid (CHEBI:15366) |
| phenylacetic acid (CHEBI:30745) has functional parent acetic acid (CHEBI:15366) |
| phosphonoacetic acid (CHEBI:15732) has functional parent acetic acid (CHEBI:15366) |
| phosphonoacetohydroxamic acid (CHEBI:44692) has functional parent acetic acid (CHEBI:15366) |
| pirinixic acid (CHEBI:32509) has functional parent acetic acid (CHEBI:15366) |
| sulfoacetic acid (CHEBI:50519) has functional parent acetic acid (CHEBI:15366) |
| sulindac (CHEBI:9352) has functional parent acetic acid (CHEBI:15366) |
| triacetin (CHEBI:9661) has functional parent acetic acid (CHEBI:15366) |
| trichloroacetic acid (CHEBI:30956) has functional parent acetic acid (CHEBI:15366) |
| trifluoroacetic acid (CHEBI:45892) has functional parent acetic acid (CHEBI:15366) |
| uracil-6-ylacetic acid (CHEBI:46371) has functional parent acetic acid (CHEBI:15366) |
| zomepirac (CHEBI:35859) has functional parent acetic acid (CHEBI:15366) |
| acetate (CHEBI:30089) is conjugate base of acetic acid (CHEBI:15366) |
| acetyl group (CHEBI:40574) is substituent group from acetic acid (CHEBI:15366) |
| acetyloxy group (CHEBI:48076) is substituent group from acetic acid (CHEBI:15366) |
| carboxymethyl group (CHEBI:41402) is substituent group from acetic acid (CHEBI:15366) |
| methylenecarbonyl group (CHEBI:43923) is substituent group from acetic acid (CHEBI:15366) |
| IUPAC Name |
|---|
| acetic acid |
| Synonyms | Source |
|---|---|
| Acetic acid | KEGG COMPOUND |
| ACETIC ACID | PDBeChem |
| acide acétique | ChemIDplus |
| AcOH | ChEBI |
| CH3‒COOH | IUPAC |
| CH3CO2H | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1333 | PPDB |
| 4211 | DrugCentral |
| ACET | MetaCyc |
| Acetic_acid | Wikipedia |
| ACT | PDBeChem |
| ACY | PDBeChem |
| C00001176 | KNApSAcK |
| C00033 | KEGG COMPOUND |
| D00010 | KEGG DRUG |
| HMDB0000042 | HMDB |
| LMFA01010002 | LIPID MAPS |
| Citations |
|---|