EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:51889 - cyanoacetic acid
| Formula | C3H3NO2 |
| Net Charge | 0 |
| Average Mass | 85.062 |
| Monoisotopic Mass | 85.01638 |
| SMILES | N#CCC(=O)O |
| InChI | InChI=1S/C3H3NO2/c4-2-1-3(5)6/h1H2,(H,5,6) |
| InChIKey | MLIREBYILWEBDM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyanoacetic acid (CHEBI:51889) has functional parent acetic acid (CHEBI:15366) |
| cyanoacetic acid (CHEBI:51889) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| cyanoacetate ester (CHEBI:51888) has functional parent cyanoacetic acid (CHEBI:51889) |
| IUPAC Name |
|---|
| cyanoacetic acid |
| Synonyms | Source |
|---|---|
| Acide cyanacetique | ChemIDplus |
| Cyanessigsäure | ChemIDplus |
| cyanoethanoic acid | ChEBI |
| Malonic acid mononitrile | ChemIDplus |
| Malonic mononitrile | ChemIDplus |
| Citations |
|---|