EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21FO2 |
| Net Charge | 0 |
| Average Mass | 336.406 |
| Monoisotopic Mass | 336.15256 |
| SMILES | CC1=C(CC(=O)O)c2cc(F)ccc2/C1=C\c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H21FO2/c1-13(2)16-6-4-15(5-7-16)10-19-14(3)20(12-22(24)25)21-11-17(23)8-9-18(19)21/h4-11,13H,12H2,1-3H3,(H,24,25)/b19-10- |
| InChIKey | QCXBVGNDRYQVJO-GRSHGNNSSA-N |
| Roles Classification |
|---|
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [5-fluoro-1-(4-isopropylbenzylidene)-2-methylinden-3-yl]acetic acid (CHEBI:59660) has functional parent acetic acid (CHEBI:15366) |
| [5-fluoro-1-(4-isopropylbenzylidene)-2-methylinden-3-yl]acetic acid (CHEBI:59660) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| [5-fluoro-1-(4-isopropylbenzylidene)-2-methylinden-3-yl]acetic acid (CHEBI:59660) is a organofluorine compound (CHEBI:37143) |
| IUPAC Name |
|---|
| [(1Z)-5-fluoro-1-(4-isopropylbenzylidene)-2-methyl-1H-inden-3-yl]acetic acid |
| Synonym | Source |
|---|---|
| K-80003 | ChEBI |
| Citations |
|---|