EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H2Cl2O2 |
| Net Charge | 0 |
| Average Mass | 128.942 |
| Monoisotopic Mass | 127.94318 |
| SMILES | O=C(O)C(Cl)Cl |
| InChI | InChI=1S/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6) |
| InChIKey | JXTHNDFMNIQAHM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dichloroacetic acid (CHEBI:36386) has functional parent acetic acid (CHEBI:15366) |
| dichloroacetic acid (CHEBI:36386) has role astringent (CHEBI:74783) |
| dichloroacetic acid (CHEBI:36386) has role marine metabolite (CHEBI:76507) |
| dichloroacetic acid (CHEBI:36386) is a monocarboxylic acid (CHEBI:25384) |
| dichloroacetic acid (CHEBI:36386) is a organochlorine compound (CHEBI:36683) |
| dichloroacetic acid (CHEBI:36386) is conjugate acid of dichloroacetate (CHEBI:28240) |
| Incoming Relation(s) |
| dichloroacetyl chloride (CHEBI:34688) has functional parent dichloroacetic acid (CHEBI:36386) |
| florfenicol (CHEBI:87185) has functional parent dichloroacetic acid (CHEBI:36386) |
| WIN 18446 (CHEBI:90441) has functional parent dichloroacetic acid (CHEBI:36386) |
| dichloroacetate (CHEBI:28240) is conjugate base of dichloroacetic acid (CHEBI:36386) |
| IUPAC Name |
|---|
| dichloroacetic acid |
| Synonyms | Source |
|---|---|
| 2,2-dichloroacetic acid | ChemIDplus |
| bichloracetic acid | NIST Chemistry WebBook |
| dichloracetic acid | NIST Chemistry WebBook |
| Dichloressigsäure | ChEBI |
| Dichloroacetate | KEGG COMPOUND |
| DICHLORO-ACETIC ACID | PDBeChem |
| Citations |
|---|