EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:61316 - (3Z)-hex-3-en-1-yl acetate
| Formula | C8H14O2 |
| Net Charge | 0 |
| Average Mass | 142.198 |
| Monoisotopic Mass | 142.09938 |
| SMILES | CC/C=C\CCOC(C)=O |
| InChI | InChI=1S/C8H14O2/c1-3-4-5-6-7-10-8(2)9/h4-5H,3,6-7H2,1-2H3/b5-4- |
| InChIKey | NPFVOOAXDOBMCE-PLNGDYQASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3Z)-hex-3-en-1-yl acetate (CHEBI:61316) has functional parent (Z)-hex-3-en-1-ol (CHEBI:28857) |
| (3Z)-hex-3-en-1-yl acetate (CHEBI:61316) has functional parent acetic acid (CHEBI:15366) |
| (3Z)-hex-3-en-1-yl acetate (CHEBI:61316) has role metabolite (CHEBI:25212) |
| (3Z)-hex-3-en-1-yl acetate (CHEBI:61316) is a acetate ester (CHEBI:47622) |
| (3Z)-hex-3-en-1-yl acetate (CHEBI:61316) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (3Z)-hex-3-en-1-yl acetate |
| Synonyms | Source |
|---|---|
| 3Z-hexenyl acetate | NIST Chemistry WebBook |
| cis-3-hexen-1-yl acetate | ChemIDplus |
| cis-3-hexenyl acetate | ChemIDplus |
| cis-3-hexenyl ethanoate | ChemIDplus |
| (Z)-3-hexen-1-yl acetate | NIST Chemistry WebBook |
| (Z)-3-hexenol acetate | NIST Chemistry WebBook |
| UniProt Name | Source |
|---|---|
| (3Z)-hex-3-en-1-yl acetate | UniProt |
| Citations |
|---|