EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13ClN2O2 |
| Net Charge | 0 |
| Average Mass | 312.756 |
| Monoisotopic Mass | 312.06656 |
| SMILES | O=C(O)Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22) |
| InChIKey | XVUQHFRQHBLHQD-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lonazolac (CHEBI:76164) has functional parent acetic acid (CHEBI:15366) |
| lonazolac (CHEBI:76164) has role antineoplastic agent (CHEBI:35610) |
| lonazolac (CHEBI:76164) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| lonazolac (CHEBI:76164) has role non-narcotic analgesic (CHEBI:35481) |
| lonazolac (CHEBI:76164) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| lonazolac (CHEBI:76164) is a monocarboxylic acid (CHEBI:25384) |
| lonazolac (CHEBI:76164) is a monochlorobenzenes (CHEBI:83403) |
| lonazolac (CHEBI:76164) is a pyrazoles (CHEBI:26410) |
| lonazolac (CHEBI:76164) is conjugate acid of lonazolac(1−) (CHEBI:76169) |
| Incoming Relation(s) |
| lonazolac(1−) (CHEBI:76169) is conjugate base of lonazolac (CHEBI:76164) |
| IUPAC Name |
|---|
| [3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]acetic acid |
| INNs | Source |
|---|---|
| lonazolac | WHO MedNet |
| lonazolac | KEGG DRUG |
| lonazolaco | ChemIDplus |
| lonazolacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(p-Chlorophenyl)-1-phenylpyrazole-4-acetic acid | ChemIDplus |
| Argun l | ChEMBL |
| Atrilon | ChEMBL |
| Irritren | ChEMBL |
| NSC-319772 | ChEMBL |
| SNK-874 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 1597 | DrugCentral |
| D07265 | KEGG DRUG |
| Lonazolac | Wikipedia |
| WO2008017903 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:53808-88-1 | KEGG DRUG |
| CAS:53808-88-1 | ChemIDplus |
| Citations |
|---|