EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6As2O4 |
| Net Charge | 0 |
| Average Mass | 267.932 |
| Monoisotopic Mass | 267.86980 |
| SMILES | O=C(O)C/[As]=[As]/CC(=O)O |
| InChI | InChI=1S/C4H6As2O4/c7-3(8)1-5-6-2-4(9)10/h1-2H2,(H,7,8)(H,9,10) |
| InChIKey | VYEDANBZSYIKMV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arsenoacetic acid (CHEBI:22634) has functional parent acetic acid (CHEBI:15366) |
| arsenoacetic acid (CHEBI:22634) has role xenobiotic (CHEBI:35703) |
| arsenoacetic acid (CHEBI:22634) is a organoarsenic compound (CHEBI:33406) |
| IUPAC Name |
|---|
| 2,2'-(E)-diarsene-1,2-diyldiacetic acid |
| Synonyms | Source |
|---|---|
| 2,2'-(1,2-diarsenediyl)bisacetic acid | ChemIDplus |
| arsenoacetic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:544-27-4 | ChemIDplus |