EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:23716 - difluoroacetic acid
| Formula | C2H2F2O2 |
| Net Charge | 0 |
| Average Mass | 96.032 |
| Monoisotopic Mass | 96.00229 |
| SMILES | O=C(O)C(F)F |
| InChI | InChI=1S/C2H2F2O2/c3-1(4)2(5)6/h1H,(H,5,6) |
| InChIKey | PBWZKZYHONABLN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| difluoroacetic acid (CHEBI:23716) has functional parent acetic acid (CHEBI:15366) |
| difluoroacetic acid (CHEBI:23716) is a monocarboxylic acid (CHEBI:25384) |
| difluoroacetic acid (CHEBI:23716) is a organofluorine compound (CHEBI:37143) |
| difluoroacetic acid (CHEBI:23716) is conjugate acid of difluoroacetate (CHEBI:23715) |
| Incoming Relation(s) |
| difluoroacetate (CHEBI:23715) is conjugate base of difluoroacetic acid (CHEBI:23716) |
| IUPAC Name |
|---|
| difluoroacetic acid |
| Synonyms | Source |
|---|---|
| DFA | ChEBI |
| Difluoressigsäure | ChEBI |