EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H4O3 |
| Net Charge | 0 |
| Average Mass | 76.051 |
| Monoisotopic Mass | 76.01604 |
| SMILES | CC(=O)OO |
| InChI | InChI=1S/C2H4O3/c1-2(3)5-4/h4H,1H3 |
| InChIKey | KFSLWBXXFJQRDL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peracetic acid (CHEBI:42530) has functional parent acetic acid (CHEBI:15366) |
| peracetic acid (CHEBI:42530) has role disinfectant (CHEBI:48219) |
| peracetic acid (CHEBI:42530) has role oxidising agent (CHEBI:63248) |
| peracetic acid (CHEBI:42530) is a a peroxy acid (CHEBI:177878) |
| IUPAC Name |
|---|
| ethaneperoxoic acid |
| Synonyms | Source |
|---|---|
| acetic peroxide | ChemIDplus |
| acetyl hydroperoxide | ChemIDplus |
| acide peracetique | DrugBank |
| acido peroxiacetico | DrugBank |
| ethaneperoxic acid | ChemIDplus |
| monoperacetic acid | ChemIDplus |
| Brand Names | Source |
|---|---|
| Acecide | KEGG DRUG |
| Desoxon 1 | ChemIDplus |
| Estosteril | ChemIDplus |
| Osbon AC | ChemIDplus |
| Proxitane 4002 | ChemIDplus |
| UniProt Name | Source |
|---|---|
| peracetic acid | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 1466 | PPDB |
| 6336 | ChemSpider |
| D03467 | KEGG DRUG |
| DB14556 | DrugBank |
| F50 | PDBeChem |
| HMDB0031608 | HMDB |
| Peracetic_acid | Wikipedia |
| Citations |
|---|