EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31483 - diflorasone diacetate
| Formula | C26H32F2O7 |
| Net Charge | 0 |
| Average Mass | 494.531 |
| Monoisotopic Mass | 494.21161 |
| SMILES | [H][C@@]12C[C@H](C)[C@](OC(C)=O)(C(=O)COC(C)=O)[C@@]1(C)C[C@H](O)[C@@]1(F)[C@@]2([H])C[C@H](F)C2=CC(=O)C=C[C@@]21C |
| InChI | InChI=1S/C26H32F2O7/c1-13-8-17-18-10-20(27)19-9-16(31)6-7-23(19,4)25(18,28)21(32)11-24(17,5)26(13,35-15(3)30)22(33)12-34-14(2)29/h6-7,9,13,17-18,20-21,32H,8,10-12H2,1-5H3/t13-,17-,18-,20-,21-,23-,24-,25-,26-/m0/s1 |
| InChIKey | BOBLHFUVNSFZPJ-JOYXJVLSSA-N |
| Roles Classification |
|---|
| Biological Role: | hormone Originally referring to an endogenous compound that is formed in specialized organ or group of cells and carried to another organ or group of cells, in the same organism, upon which it has a specific regulatory function, the term is now commonly used to include non-endogenous, semi-synthetic and fully synthetic analogues of such compounds. |
| Applications: | antipruritic drug A drug, usually applied topically, that relieves pruritus (itching). anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diflorasone diacetate (CHEBI:31483) has functional parent acetic acid (CHEBI:15366) |
| diflorasone diacetate (CHEBI:31483) has functional parent diflorasone (CHEBI:59750) |
| diflorasone diacetate (CHEBI:31483) has parent hydride pregnane (CHEBI:8386) |
| diflorasone diacetate (CHEBI:31483) has role anti-inflammatory drug (CHEBI:35472) |
| diflorasone diacetate (CHEBI:31483) has role antipruritic drug (CHEBI:59683) |
| diflorasone diacetate (CHEBI:31483) is a 11β-hydroxy steroid (CHEBI:35346) |
| diflorasone diacetate (CHEBI:31483) is a 20-oxo steroid (CHEBI:36885) |
| diflorasone diacetate (CHEBI:31483) is a 3-oxo-Δ1,Δ4-steroid (CHEBI:77166) |
| diflorasone diacetate (CHEBI:31483) is a acetate ester (CHEBI:47622) |
| diflorasone diacetate (CHEBI:31483) is a fluorinated steroid (CHEBI:50830) |
| diflorasone diacetate (CHEBI:31483) is a glucocorticoid (CHEBI:24261) |
| IUPAC Name |
|---|
| 6α,9-difluoro-11β-hydroxy-16β-methyl-3,20-dioxopregna-1,4-diene-17,21-diyl diacetate |
| Synonyms | Source |
|---|---|
| (6α,11β,16β)-6,9-difluoro-11-hydroxy-16-methyl-3,20-dioxopregna-1,4-diene-17,21-diyl diacetate | ChEBI |
| 6α,9-difluoro-11β,17,21-trihydroxy-16β-methylpregna-1,4-diene-3,20-dione 17,21-diacetate | ChemIDplus |
| diflorasone 17,21-diacetate | ChEBI |
| diflorasone di(acetate) | ChemIDplus |