EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12Cl2O4 |
| Net Charge | 0 |
| Average Mass | 303.141 |
| Monoisotopic Mass | 302.01126 |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | AVOLMBLBETYQHX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.5.1.18 (glutathione transferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of a glutathione transferase (EC 2.5.1.18). ion transport inhibitor A compound which inhibits the movement of an ion across an energy-transducing cell membrane. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antifibrotic agent Any agent which acts to reduce fibrosis. antiglaucoma drug Any drug which can be used to prevent or alleviate glaucoma, a disease in which the optic nerve is damaged, resulting in progressive, irreversible loss of vision. It is often, though not always, associated with increased pressure of the fluid in the eye. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. loop diuretic A diuretic that acts on the ascending loop of Henle in the kidney. renoprotective agent Any compound that is able to prevent damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etacrynic acid (CHEBI:4876) has functional parent acetic acid (CHEBI:15366) |
| etacrynic acid (CHEBI:4876) has role antifibrotic agent (CHEBI:233423) |
| etacrynic acid (CHEBI:4876) has role antiglaucoma drug (CHEBI:39456) |
| etacrynic acid (CHEBI:4876) has role antineoplastic agent (CHEBI:35610) |
| etacrynic acid (CHEBI:4876) has role cardiovascular drug (CHEBI:35554) |
| etacrynic acid (CHEBI:4876) has role EC 2.5.1.18 (glutathione transferase) inhibitor (CHEBI:76797) |
| etacrynic acid (CHEBI:4876) has role ion transport inhibitor (CHEBI:50184) |
| etacrynic acid (CHEBI:4876) has role loop diuretic (CHEBI:77608) |
| etacrynic acid (CHEBI:4876) has role renoprotective agent (CHEBI:231911) |
| etacrynic acid (CHEBI:4876) is a aromatic ether (CHEBI:35618) |
| etacrynic acid (CHEBI:4876) is a aromatic ketone (CHEBI:76224) |
| etacrynic acid (CHEBI:4876) is a dichlorobenzene (CHEBI:23697) |
| etacrynic acid (CHEBI:4876) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| etacrynate (CHEBI:760756) is conjugate base of etacrynic acid (CHEBI:4876) |
| IUPAC Name |
|---|
| [2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid |
| INNs | Source |
|---|---|
| acide étacrynique | WHO MedNet |
| ácido etacrínico | WHO MedNet |
| acidum etacrynicum | WHO MedNet |
| etacrynic acid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (2,3-Dichloro-4-(2-methylene-1-oxobutyl)phenoxy)acetic acid | ChemIDplus |
| Etacrinic acid | DrugBank |
| Ethacrynate | DrugBank |
| ethacrynic acid | ChEMBL |
| ethacrynic acid | ChemIDplus |
| Methylenebutyrylphenoxyacetic acid | DrugBank |
| Brand Names | Source |
|---|---|
| Crinuryl | DrugBank |
| Edecril | DrugBank |
| Edecrin | ChEMBL |
| Edecrina | DrugBank |
| Endecril | DrugBank |
| Hidromedin | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1071 | DrugCentral |
| D00313 | KEGG DRUG |
| DB00903 | DrugBank |
| EAA | PDBeChem |
| Etacrynic_acid | Wikipedia |
| HMDB0015039 | HMDB |
| LSM-3420 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1915060 | Reaxys |
| CAS:58-54-8 | KEGG DRUG |
| CAS:58-54-8 | ChemIDplus |
| Citations |
|---|