EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12Cl2O4 |
| Net Charge | 0 |
| Average Mass | 303.141 |
| Monoisotopic Mass | 302.01126 |
| SMILES | C=C(CC)C(=O)c1ccc(OCC(=O)O)c(Cl)c1Cl |
| InChI | InChI=1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | AVOLMBLBETYQHX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 2.5.1.18 (glutathione transferase) inhibitor An EC 2.5.1.* (non-methyl-alkyl or aryl transferase) inhibitor that interferes with the action of a glutathione transferase (EC 2.5.1.18). ion transport inhibitor A compound which inhibits the movement of an ion across an energy-transducing cell membrane. |
| Application: | loop diuretic A diuretic that acts on the ascending loop of Henle in the kidney. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etacrynic acid (CHEBI:4876) has functional parent acetic acid (CHEBI:15366) |
| etacrynic acid (CHEBI:4876) has role EC 2.5.1.18 (glutathione transferase) inhibitor (CHEBI:76797) |
| etacrynic acid (CHEBI:4876) has role ion transport inhibitor (CHEBI:50184) |
| etacrynic acid (CHEBI:4876) has role loop diuretic (CHEBI:77608) |
| etacrynic acid (CHEBI:4876) is a aromatic ether (CHEBI:35618) |
| etacrynic acid (CHEBI:4876) is a aromatic ketone (CHEBI:76224) |
| etacrynic acid (CHEBI:4876) is a dichlorobenzene (CHEBI:23697) |
| etacrynic acid (CHEBI:4876) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| [2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid |
| INNs | Source |
|---|---|
| acide étacrynique | WHO MedNet |
| ácido etacrínico | WHO MedNet |
| acidum etacrynicum | WHO MedNet |
| etacrynic acid | KEGG DRUG |
| Synonyms | Source |
|---|---|
| (2,3-Dichloro-4-(2-methylene-1-oxobutyl)phenoxy)acetic acid | ChemIDplus |
| Etacrinic acid | DrugBank |
| Ethacrynate | DrugBank |
| ethacrynic acid | ChemIDplus |
| Methylenebutyrylphenoxyacetic acid | DrugBank |
| Brand Names | Source |
|---|---|
| Crinuryl | DrugBank |
| Edecril | DrugBank |
| Edecrina | DrugBank |
| Endecril | DrugBank |
| Hidromedin | DrugBank |
| Hydromedin | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| 1071 | DrugCentral |
| D00313 | KEGG DRUG |
| DB00903 | DrugBank |
| EAA | PDBeChem |
| Etacrynic_acid | Wikipedia |
| HMDB0015039 | HMDB |
| LSM-3420 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1915060 | Reaxys |
| CAS:58-54-8 | KEGG DRUG |
| CAS:58-54-8 | ChemIDplus |
| Citations |
|---|