EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O2 |
| Net Charge | 0 |
| Average Mass | 192.258 |
| Monoisotopic Mass | 192.11503 |
| SMILES | CC(C)Cc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C12H16O2/c1-9(2)7-10-3-5-11(6-4-10)8-12(13)14/h3-6,9H,7-8H2,1-2H3,(H,13,14) |
| InChIKey | CYWFCPPBTWOZSF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor A compound or agent that combines with cyclooxygenases (EC 1.14.99.1) and thereby prevents its substrate-enzyme combination with arachidonic acid and the formation of icosanoids, prostaglandins, and thromboxanes. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ibufenac (CHEBI:76158) has functional parent acetic acid (CHEBI:15366) |
| ibufenac (CHEBI:76158) has role EC 1.14.99.1 (prostaglandin-endoperoxide synthase) inhibitor (CHEBI:35544) |
| ibufenac (CHEBI:76158) has role hepatotoxic agent (CHEBI:50908) |
| ibufenac (CHEBI:76158) has role non-narcotic analgesic (CHEBI:35481) |
| ibufenac (CHEBI:76158) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| ibufenac (CHEBI:76158) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Names |
|---|
| [4-(2-methylpropyl)phenyl]acetic acid |
| (4-isobutylphenyl)acetic acid |
| INNs | Source |
|---|---|
| ibufenac | KEGG DRUG |
| ibufenaco | ChemIDplus |
| ibufenacum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(2-Methylpropyl)benzeneacetic acid | ChemIDplus |
| 4-Isobutylphenylacetic acid | ChemIDplus |
| Ibunac | ChemIDplus |
| (p-Isobutylphenyl)acetic acid | ChemIDplus |
| Brand Name | Source |
|---|---|
| Dytransin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3293 | DrugCentral |
| D01963 | KEGG DRUG |
| US2008014272 | Patent |
| US2011212904 | Patent |
| US4391814 | Patent |
| WO2010013279 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2046683 | Reaxys |
| CAS:1553-60-2 | ChemIDplus |
| CAS:1553-60-2 | KEGG DRUG |
| Citations |
|---|