EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9661 - triacetin
| Formula | C9H14O6 |
| Net Charge | 0 |
| Average Mass | 218.205 |
| Monoisotopic Mass | 218.07904 |
| SMILES | CC(=O)OCC(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C9H14O6/c1-6(10)13-4-9(15-8(3)12)5-14-7(2)11/h9H,4-5H2,1-3H3 |
| InChIKey | URAYPUMNDPQOKB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | food additive carrier A food additive that is used to dilute, disperse or dissolve a food additive or nutrient without altering its function. Carriers are used to facilitate the handling or use of the food additive or nutrient. food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. solvent A substance that dissolves other substances (solutes) to form a solution without any change in their chemical composition. fuel additive Any additive that enhances the efficiency of fuel. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. |
| Biological Roles: | food additive carrier A food additive that is used to dilute, disperse or dissolve a food additive or nutrient without altering its function. Carriers are used to facilitate the handling or use of the food additive or nutrient. food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | food additive carrier A food additive that is used to dilute, disperse or dissolve a food additive or nutrient without altering its function. Carriers are used to facilitate the handling or use of the food additive or nutrient. food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. adjuvant Any pharmacological or immunological agent that modifies the effect of other agents such as drugs or vaccines while having few if any direct effects when given by itself. solvent A substance that dissolves other substances (solutes) to form a solution without any change in their chemical composition. fuel additive Any additive that enhances the efficiency of fuel. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triacetin (CHEBI:9661) has functional parent acetic acid (CHEBI:15366) |
| triacetin (CHEBI:9661) has role adjuvant (CHEBI:60809) |
| triacetin (CHEBI:9661) has role antifungal drug (CHEBI:86327) |
| triacetin (CHEBI:9661) has role food additive carrier (CHEBI:78059) |
| triacetin (CHEBI:9661) has role food emulsifier (CHEBI:63047) |
| triacetin (CHEBI:9661) has role food humectant (CHEBI:77969) |
| triacetin (CHEBI:9661) has role fuel additive (CHEBI:62803) |
| triacetin (CHEBI:9661) has role plant metabolite (CHEBI:76924) |
| triacetin (CHEBI:9661) has role solvent (CHEBI:46787) |
| triacetin (CHEBI:9661) is a triglyceride (CHEBI:17855) |
| IUPAC Name |
|---|
| propane-1,2,3-triyl triacetate |
| INNs | Source |
|---|---|
| triacetin | KEGG DRUG |
| triacetina | ChemIDplus |
| triacetine | ChemIDplus |
| triacetinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,2,3-Propanetriol triacetate | HMDB |
| 1,2,3-Propanetriyl triacetate | HMDB |
| 1,2,3-triacetoxypropane | LIPID MAPS |
| 1,2,3-triacetylglycerol | LIPID MAPS |
| 2-(Acetyloxy)-1-[(acetyloxy)methyl]ethyl acetate | HMDB |
| E 1518 | ChEBI |
| Brand Name | Source |
|---|---|
| Enzactin | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| triacetin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3624 | DrugCentral |
| D00384 | KEGG DRUG |
| HMDB0029592 | HMDB |
| LMGL03012615 | LIPID MAPS |
| Triacetin | Wikipedia |
| Citations |
|---|