EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:9661 - triacetin
| Formula | C9H14O6 |
| Net Charge | 0 |
| Average Mass | 218.205 |
| Monoisotopic Mass | 218.07904 |
| SMILES | CC(=O)OCC(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C9H14O6/c1-6(10)13-4-9(15-8(3)12)5-14-7(2)11/h9H,4-5H2,1-3H3 |
| InChIKey | URAYPUMNDPQOKB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. fuel additive Any additive that enhances the efficiency of fuel. |
| Biological Roles: | food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. food additive carrier A food additive that is used to dilute, disperse or dissolve a food additive or nutrient without altering its function. Carriers are used to facilitate the handling or use of the food additive or nutrient. food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | adjuvant Any pharmacological or immunological agent that modifies the effect of other agents such as drugs or vaccines while having few if any direct effects when given by itself. food humectant A humectant that is used as a food additive to prevent foodstuffs from drying out. solvent A liquid that can dissolve other substances (solutes) without any change in their chemical composition. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. food additive carrier A food additive that is used to dilute, disperse or dissolve a food additive or nutrient without altering its function. Carriers are used to facilitate the handling or use of the food additive or nutrient. food emulsifier A food additive used to form or maintain a uniform emulsion of two (or more) phases in a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triacetin (CHEBI:9661) has functional parent acetic acid (CHEBI:15366) |
| triacetin (CHEBI:9661) has role adjuvant (CHEBI:60809) |
| triacetin (CHEBI:9661) has role antifungal drug (CHEBI:86327) |
| triacetin (CHEBI:9661) has role food additive carrier (CHEBI:78059) |
| triacetin (CHEBI:9661) has role food emulsifier (CHEBI:63047) |
| triacetin (CHEBI:9661) has role food humectant (CHEBI:77969) |
| triacetin (CHEBI:9661) has role fuel additive (CHEBI:62803) |
| triacetin (CHEBI:9661) has role plant metabolite (CHEBI:76924) |
| triacetin (CHEBI:9661) has role solvent (CHEBI:46787) |
| triacetin (CHEBI:9661) is a triglyceride (CHEBI:17855) |
| IUPAC Name |
|---|
| propane-1,2,3-triyl triacetate |
| INNs | Source |
|---|---|
| triacetin | KEGG DRUG |
| triacetina | ChemIDplus |
| triacetine | ChemIDplus |
| triacetinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1,2,3-Propanetriol triacetate | HMDB |
| 1,2,3-Propanetriyl triacetate | HMDB |
| 1,2,3-triacetoxypropane | LIPID MAPS |
| 1,2,3-triacetylglycerol | LIPID MAPS |
| 2-(Acetyloxy)-1-[(acetyloxy)methyl]ethyl acetate | HMDB |
| E 1518 | ChEBI |
| Brand Name | Source |
|---|---|
| Enzactin | KEGG DRUG |
| UniProt Name | Source |
|---|---|
| triacetin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 3624 | DrugCentral |
| D00384 | KEGG DRUG |
| HMDB0029592 | HMDB |
| LMGL03012615 | LIPID MAPS |
| Triacetin | Wikipedia |
| Citations |
|---|