EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H14ClNO3 |
| Net Charge | 0 |
| Average Mass | 291.734 |
| Monoisotopic Mass | 291.06622 |
| SMILES | Cc1cc(CC(=O)O)n(C)c1C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClNO3/c1-9-7-12(8-13(18)19)17(2)14(9)15(20)10-3-5-11(16)6-4-10/h3-7H,8H2,1-2H3,(H,18,19) |
| InChIKey | ZXVNMYWKKDOREA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zomepirac (CHEBI:35859) has functional parent acetic acid (CHEBI:15366) |
| zomepirac (CHEBI:35859) has role cardiovascular drug (CHEBI:35554) |
| zomepirac (CHEBI:35859) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| zomepirac (CHEBI:35859) is a aromatic ketone (CHEBI:76224) |
| zomepirac (CHEBI:35859) is a monocarboxylic acid (CHEBI:25384) |
| zomepirac (CHEBI:35859) is a monochlorobenzenes (CHEBI:83403) |
| zomepirac (CHEBI:35859) is a pyrroles (CHEBI:26455) |
| IUPAC Name |
|---|
| [5-(4-chlorobenzoyl)-1,4-dimethyl-1H-pyrrol-2-yl]acetic acid |
| Synonyms | Source |
|---|---|
| 5-(4-chlorobenzoyl)-1,4-dimethyl-1H-pyrrole-2-acetic acid | ChemIDplus |
| Zomepirac | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:487946 | Beilstein |
| CAS:33369-31-2 | ChemIDplus |