EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7ClO3 |
| Net Charge | 0 |
| Average Mass | 186.594 |
| Monoisotopic Mass | 186.00837 |
| SMILES | O=C(O)Cc1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C8H7ClO3/c9-6-3-5(4-8(11)12)1-2-7(6)10/h1-3,10H,4H2,(H,11,12) |
| InChIKey | IYTUKSIOQKTZEG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3-chloro-4-hydroxyphenyl)acetic acid (CHEBI:47106) has functional parent acetic acid (CHEBI:15366) |
| (3-chloro-4-hydroxyphenyl)acetic acid (CHEBI:47106) has role mammalian metabolite (CHEBI:75768) |
| (3-chloro-4-hydroxyphenyl)acetic acid (CHEBI:47106) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| (3-chloro-4-hydroxyphenyl)acetic acid (CHEBI:47106) is a monochlorobenzenes (CHEBI:83403) |
| (3-chloro-4-hydroxyphenyl)acetic acid (CHEBI:47106) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| (3-chloro-4-hydroxyphenyl)acetic acid |
| Synonyms | Source |
|---|---|
| 3-chloro-4-hydroxyphenylacetic acid | ChEBI |
| 3-Chloro-4-hydroxybenzeneacetic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2096929 | Reaxys |
| CAS:33697-81-3 | ChemIDplus |
| Citations |
|---|