EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:90124 - dibromoacetic acid
| Formula | C2H2Br2O2 |
| Net Charge | 0 |
| Average Mass | 217.844 |
| Monoisotopic Mass | 215.84215 |
| SMILES | O=C(O)C(Br)Br |
| InChI | InChI=1S/C2H2Br2O2/c3-1(4)2(5)6/h1H,(H,5,6) |
| InChIKey | SIEILFNCEFEENQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibromoacetic acid (CHEBI:90124) has functional parent acetic acid (CHEBI:15366) |
| dibromoacetic acid (CHEBI:90124) has role apoptosis inducer (CHEBI:68495) |
| dibromoacetic acid (CHEBI:90124) has role geroprotector (CHEBI:176497) |
| dibromoacetic acid (CHEBI:90124) has role marine metabolite (CHEBI:76507) |
| dibromoacetic acid (CHEBI:90124) is a 2-bromocarboxylic acid (CHEBI:134367) |
| dibromoacetic acid (CHEBI:90124) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| dibromoacetic acid |
| Synonyms | Source |
|---|---|
| 2,2-Dibromoacetic acid | KEGG COMPOUND |
| 2,2-dibromoethanoic acid | LIPID MAPS |
| DBAA | KEGG COMPOUND |
| Dibromoethanoic acid | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 11926 | ChemSpider |
| C20123 | KEGG COMPOUND |
| LMFA01090076 | LIPID MAPS |
| Citations |
|---|