EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132098 - methoxyacetic acid
| Formula | C3H6O3 |
| Net Charge | 0 |
| Average Mass | 90.078 |
| Monoisotopic Mass | 90.03169 |
| SMILES | COCC(=O)O |
| InChI | InChI=1S/C3H6O3/c1-6-2-3(4)5/h2H2,1H3,(H,4,5) |
| InChIKey | RMIODHQZRUFFFF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methoxyacetic acid (CHEBI:132098) has functional parent acetic acid (CHEBI:15366) |
| methoxyacetic acid (CHEBI:132098) has role antineoplastic agent (CHEBI:35610) |
| methoxyacetic acid (CHEBI:132098) has role apoptosis inducer (CHEBI:68495) |
| methoxyacetic acid (CHEBI:132098) has role human xenobiotic metabolite (CHEBI:76967) |
| methoxyacetic acid (CHEBI:132098) has role mutagen (CHEBI:25435) |
| methoxyacetic acid (CHEBI:132098) is a ether (CHEBI:25698) |
| methoxyacetic acid (CHEBI:132098) is a monocarboxylic acid (CHEBI:25384) |
| methoxyacetic acid (CHEBI:132098) is conjugate acid of methoxyacetate (CHEBI:132097) |
| Incoming Relation(s) |
| methoxyacetate (CHEBI:132097) is conjugate base of methoxyacetic acid (CHEBI:132098) |
| IUPAC Name |
|---|
| methoxyacetic acid |
| Synonyms | Source |
|---|---|
| 2-Methoxyacetic acid | ChemIDplus |
| CH3OCH2COOH | NIST Chemistry WebBook |
| Methoxyethanoic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| CPD-12993 | MetaCyc |
| HMDB0041929 | HMDB |
| Citations |
|---|