EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H8O4 |
| Net Charge | 0 |
| Average Mass | 168.148 |
| Monoisotopic Mass | 168.04226 |
| SMILES | O=C(O)Cc1c(O)cccc1O |
| InChI | InChI=1S/C8H8O4/c9-6-2-1-3-7(10)5(6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12) |
| InChIKey | CROCAQYJJNCZQH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2,6-dihydroxyphenyl)acetic acid (CHEBI:952) has functional parent acetic acid (CHEBI:15366) |
| (2,6-dihydroxyphenyl)acetic acid (CHEBI:952) is a dihydroxyphenylacetic acid (CHEBI:61409) |
| (2,6-dihydroxyphenyl)acetic acid (CHEBI:952) is conjugate acid of (2,6-dihydroxyphenyl)acetate (CHEBI:28440) |
| Incoming Relation(s) |
| (2,6-dihydroxyphenyl)acetate (CHEBI:28440) is conjugate base of (2,6-dihydroxyphenyl)acetic acid (CHEBI:952) |
| IUPAC Name |
|---|
| (2,6-dihydroxyphenyl)acetic acid |
| Manual Xrefs | Databases |
|---|---|
| C06207 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6891610 | Reaxys |