EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10O3S |
| Net Charge | 0 |
| Average Mass | 234.276 |
| Monoisotopic Mass | 234.03507 |
| SMILES | O=C(O)C(O)(c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C12H10O3S/c13-11(14)12(15,10-7-4-8-16-10)9-5-2-1-3-6-9/h1-8,15H,(H,13,14) |
| InChIKey | BIHFCPRVAAVAPP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxy(phenyl)2-thienylacetic acid (CHEBI:64444) has functional parent acetic acid (CHEBI:15366) |
| hydroxy(phenyl)2-thienylacetic acid (CHEBI:64444) has role hapten (CHEBI:59174) |
| hydroxy(phenyl)2-thienylacetic acid (CHEBI:64444) is a 2-hydroxy monocarboxylic acid (CHEBI:49302) |
| hydroxy(phenyl)2-thienylacetic acid (CHEBI:64444) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| hydroxy(phenyl)2-thienylacetic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxy-2-(2-thenyl)phenylacetic acid | ChEBI |
| 2-hydroxy-2-phenyl-2-(2-thienyl)acetic acid | ChEBI |
| phenyl(2-thienyl)glycolic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:188636 | Reaxys |
| Citations |
|---|