EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:31597 - biphenyl-4-ylacetic acid
| Formula | C14H12O2 |
| Net Charge | 0 |
| Average Mass | 212.248 |
| Monoisotopic Mass | 212.08373 |
| SMILES | O=C(O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16) |
| InChIKey | QRZAKQDHEVVFRX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has functional parent acetic acid (CHEBI:15366) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has part biphenyl-4-yl group (CHEBI:35447) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| biphenyl-4-ylacetic acid (CHEBI:31597) is a biphenyls (CHEBI:22888) |
| biphenyl-4-ylacetic acid (CHEBI:31597) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| difenpiramide (CHEBI:76130) has functional parent biphenyl-4-ylacetic acid (CHEBI:31597) |
| IUPAC Name |
|---|
| [1,1'-biphenyl]-4-ylacetic acid |
| INN | Source |
|---|---|
| felbinac | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-biphenylacetic acid | ChemIDplus |
| 4-biphenylylacetic acid | ChemIDplus |
| 4-carboxymethylbiphenyl | ChemIDplus |
| Dolinac | ChemIDplus |
| p-biphenylylacetic acid | ChemIDplus |
| Felbinac | ChemIDplus |
| Citations |
|---|