EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O2 |
| Net Charge | 0 |
| Average Mass | 212.248 |
| Monoisotopic Mass | 212.08373 |
| SMILES | O=C(O)Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16) |
| InChIKey | QRZAKQDHEVVFRX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has functional parent acetic acid (CHEBI:15366) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has part biphenyl-4-yl group (CHEBI:35447) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has role analgesic (CHEBI:35480) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has role antineoplastic agent (CHEBI:35610) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| biphenyl-4-ylacetic acid (CHEBI:31597) has role renoprotective agent (CHEBI:231911) |
| biphenyl-4-ylacetic acid (CHEBI:31597) is a biphenyls (CHEBI:22888) |
| biphenyl-4-ylacetic acid (CHEBI:31597) is a monocarboxylic acid (CHEBI:25384) |
| Incoming Relation(s) |
| difenpiramide (CHEBI:76130) has functional parent biphenyl-4-ylacetic acid (CHEBI:31597) |
| IUPAC Name |
|---|
| [1,1'-biphenyl]-4-ylacetic acid |
| INNs | Source |
|---|---|
| felbinac | ChemIDplus |
| felbinaco | WHO MedNet |
| Synonyms | Source |
|---|---|
| 4-biphenylacetic acid | ChemIDplus |
| 4-biphenylylacetic acid | ChemIDplus |
| 4-carboxymethylbiphenyl | ChemIDplus |
| CL 83,544 | ChEMBL |
| CL-83544 | ChEMBL |
| Dolinac | ChemIDplus |
| Brand Name | Source |
|---|---|
| Napageln | ChEMBL |
| Citations |
|---|