EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12O2 |
| Net Charge | 0 |
| Average Mass | 212.248 |
| Monoisotopic Mass | 212.08373 |
| SMILES | O=C(O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13H,(H,15,16) |
| InChIKey | PYHXGXCGESYPCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenylacetic acid (CHEBI:41967) has functional parent acetic acid (CHEBI:15366) |
| diphenylacetic acid (CHEBI:41967) has role xenobiotic metabolite (CHEBI:76206) |
| diphenylacetic acid (CHEBI:41967) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| diphenylacetic acid |
| Synonyms | Source |
|---|---|
| diphenylethanoic acid | ChemIDplus |
| 2,2-diphenylacetic acid | ChEBI |
| α-phenylbenzeneacetic acid | ChEBI |
| Citations |
|---|