EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1O |
| InChI | InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ |
| InChIKey | KSEBMYQBYZTDHS-HWKANZROSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ligusticum porteri (ncbitaxon:54719) | root (BTO:0001188) | PubMed (20879744) | Air-dried and pulverized roots were macerated with CH2Cl2-MeOH(1:1) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | MALDI matrix material A compound used to form the matrix for MALDI (matrix-assisted laser desorption/ionization) mass spectrometry. MALDI matrix materials are crystalline compounds with a fairly low molecular weight, so as to allow facile vaporization, have strong absorption at UV or IR wavelengths (to rapidly and efficiently absorb laser irradiation), generally contain polar groups (enabling them to be used in aqueous solutions) and are frequently acidic (so assisting ionisation of the compound being studied, which is contained within the matrix material). cardioprotective agent Any protective agent that is able to prevent damage to the heart. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-ferulic acid (CHEBI:17620) has role anti-inflammatory agent (CHEBI:67079) |
| trans-ferulic acid (CHEBI:17620) has role antioxidant (CHEBI:22586) |
| trans-ferulic acid (CHEBI:17620) has role apoptosis inhibitor (CHEBI:68494) |
| trans-ferulic acid (CHEBI:17620) has role cardioprotective agent (CHEBI:77307) |
| trans-ferulic acid (CHEBI:17620) has role MALDI matrix material (CHEBI:64345) |
| trans-ferulic acid (CHEBI:17620) has role plant metabolite (CHEBI:76924) |
| trans-ferulic acid (CHEBI:17620) is a ferulic acid (CHEBI:193350) |
| trans-ferulic acid (CHEBI:17620) is conjugate acid of trans-ferulate (CHEBI:29749) |
| Incoming Relation(s) |
| (+)-DCA-CC (CHEBI:132250) has functional parent trans-ferulic acid (CHEBI:17620) |
| (+)-DCA-CL (CHEBI:132251) has functional parent trans-ferulic acid (CHEBI:17620) |
| (R)-N-trans-feruloyloctopamine (CHEBI:67373) has functional parent trans-ferulic acid (CHEBI:17620) |
| (−)-DCA-CC (CHEBI:132249) has functional parent trans-ferulic acid (CHEBI:17620) |
| (−)-DCA-CL (CHEBI:132247) has functional parent trans-ferulic acid (CHEBI:17620) |
| (2E)-3-(4-{[1-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-3-(sulfooxy)propan-2-yl]oxy}-3-methoxyphenyl)prop-2-enoic acid (CHEBI:91208) has functional parent trans-ferulic acid (CHEBI:17620) |
| (2E)-3-(4-{[3-hydroxy-1-(4-hydroxy-3-methoxyphenyl)-1-(sulfooxy)propan-2-yl]oxy}-3-methoxyphenyl)prop-2-enoic acid (CHEBI:91206) has functional parent trans-ferulic acid (CHEBI:17620) |
| (2E)-3-[4-({1,3-dihydroxy-1-[3-methoxy-4-(sulfooxy)phenyl]propan-2-yl}oxy)-3-methoxyphenyl]prop-2-enoic acid (CHEBI:91205) has functional parent trans-ferulic acid (CHEBI:17620) |
| (2R,3R)-trans-fertaric acid (CHEBI:76116) has functional parent trans-ferulic acid (CHEBI:17620) |
| (2R,3S)-glycosmisic acid (CHEBI:132245) has functional parent trans-ferulic acid (CHEBI:17620) |
| (2S,3R)-glycosmisic acid (CHEBI:132257) has functional parent trans-ferulic acid (CHEBI:17620) |
| (2S,3S)-trans-fertaric acid (CHEBI:76120) has functional parent trans-ferulic acid (CHEBI:17620) |
| Cuscuta propenamide 2 (CHEBI:65701) has functional parent trans-ferulic acid (CHEBI:17620) |
| N-trans-feruloyl-4'-O-methyldopamine (CHEBI:67378) has functional parent trans-ferulic acid (CHEBI:17620) |
| N-feruloylserotonin (CHEBI:85158) has functional parent trans-ferulic acid (CHEBI:17620) |
| N1,N5-dihydroxyferuloyl-N10-sinapoyl spermidine (CHEBI:61516) has functional parent trans-ferulic acid (CHEBI:17620) |
| N1,N5,N10-tris-(E)-feruloyl spermidine (CHEBI:232326) has functional parent trans-ferulic acid (CHEBI:17620) |
| O-acetylferulic acid (CHEBI:86582) has functional parent trans-ferulic acid (CHEBI:17620) |
| trans-methylferulate (CHEBI:67379) has functional parent trans-ferulic acid (CHEBI:17620) |
| 1-O-feruloyl-β-D-glucose (CHEBI:81321) has functional parent trans-ferulic acid (CHEBI:17620) |
| 1-caffeoyl-5-feruloylquinic acid (CHEBI:88343) has functional parent trans-ferulic acid (CHEBI:17620) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) has functional parent trans-ferulic acid (CHEBI:17620) |
| 16-feruloyloxypalmitic acid (CHEBI:55330) has functional parent trans-ferulic acid (CHEBI:17620) |
| 2''-O-(6-feruloylglucosyl)isovitexin (CHEBI:75554) has functional parent trans-ferulic acid (CHEBI:17620) |
| 3-O-feruloyl-D-quinic acid (CHEBI:86388) has functional parent trans-ferulic acid (CHEBI:17620) |
| 3-O-feruloylcycloartenol (CHEBI:69436) has functional parent trans-ferulic acid (CHEBI:17620) |
| 4-O-feruloyl-D-quinic acid (CHEBI:18013) has functional parent trans-ferulic acid (CHEBI:17620) |
| 4-O-β-D-glucosyl-trans-ferulic acid (CHEBI:139435) has functional parent trans-ferulic acid (CHEBI:17620) |
| 7-O-(6-feruoylglucosyl)isoorientin (CHEBI:75517) has functional parent trans-ferulic acid (CHEBI:17620) |
| 8,5'-diferulic acid (CHEBI:88363) has functional parent trans-ferulic acid (CHEBI:17620) |
| avenanthramide B (CHEBI:167489) has functional parent trans-ferulic acid (CHEBI:17620) |
| curcumin (CHEBI:3962) has functional parent trans-ferulic acid (CHEBI:17620) |
| ferulic acid 4-sulfate (CHEBI:133508) has functional parent trans-ferulic acid (CHEBI:17620) |
| feruloyl-CoA (CHEBI:14261) has functional parent trans-ferulic acid (CHEBI:17620) |
| feruloylagmatine (CHEBI:75544) has functional parent trans-ferulic acid (CHEBI:17620) |
| feruloylglycoside (CHEBI:142427) has functional parent trans-ferulic acid (CHEBI:17620) |
| glycosmisic acid (CHEBI:91209) has functional parent trans-ferulic acid (CHEBI:17620) |
| isovitexin 7-O-[feruloyl]-glucoside (CHEBI:75368) has functional parent trans-ferulic acid (CHEBI:17620) |
| methyl 4-acetoxy-3-methoxycinnamate (CHEBI:86585) has functional parent trans-ferulic acid (CHEBI:17620) |
| Diferulic acid (CHEBI:27420) is a trans-ferulic acid (CHEBI:17620) |
| trans-ferulate (CHEBI:29749) is conjugate base of trans-ferulic acid (CHEBI:17620) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 3-(4-Hydroxy-3-methoxyphenyl)propenoic acid | NIST Chemistry WebBook |
| 3-methoxy-4-hydroxy-trans-cinnamic acid | ChEBI |
| 4-hydroxy-3-methoxycinnamic acid | ChEBI |
| 4-Hydroxy-3-methoxycinnamic acid | KEGG COMPOUND |
| (E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid | NIST Chemistry WebBook |
| (E)-4-Hydroxy-3-methoxycinnamic acid | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00002743 | KNApSAcK |
| C01494 | KEGG COMPOUND |
| FER | PDBeChem |
| Ferulic_Acid | Wikipedia |
| FERULIC-ACID | MetaCyc |
| HMDB0000954 | HMDB |
| Citations |
|---|