EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O4 |
| Net Charge | 0 |
| Average Mass | 194.186 |
| Monoisotopic Mass | 194.05791 |
| SMILES | [H]C(=Cc1ccc(O)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13) |
| InChIKey | KSEBMYQBYZTDHS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | feces (BTO:0000440) | MetaboLights (MTBLS5335) |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferulic acid (CHEBI:193350) has role antioxidant (CHEBI:22586) |
| ferulic acid (CHEBI:193350) has role neuroprotective agent (CHEBI:63726) |
| ferulic acid (CHEBI:193350) has role plant metabolite (CHEBI:76924) |
| ferulic acid (CHEBI:193350) is a ferulic acids (CHEBI:24031) |
| Incoming Relation(s) |
| N1,N5,N10-triferuloyl spermidine (CHEBI:81479) has functional parent ferulic acid (CHEBI:193350) |
| feruloylquinic acid (CHEBI:233523) has functional parent ferulic acid (CHEBI:193350) |
| cis-ferulic acid (CHEBI:76117) is a ferulic acid (CHEBI:193350) |
| trans-ferulic acid (CHEBI:17620) is a ferulic acid (CHEBI:193350) |
| IUPAC Name |
|---|
| 3-(4-hydroxy-3-methoxyphenyl)prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| 3-(4-hydroxy-3-methoxyphenyl)-2-propenoic acid | NIST Chemistry WebBook |
| 3-(4-hydroxy-3-methoxyphenyl)acrylic acid | NIST Chemistry WebBook |
| 3-methoxy-4-hydroxycinnamic acid | NIST Chemistry WebBook |
| 4-hydroxy-3-methoxycinnamic acid | NIST Chemistry WebBook |
| 4'-hydroxy-3'-methoxycinnamic acid | ChEBI |
| coniferic acid | ChEBI |
| Citations |
|---|