EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H40O6 |
| Net Charge | 0 |
| Average Mass | 448.600 |
| Monoisotopic Mass | 448.28249 |
| SMILES | COc1cc(/C=C/C(=O)OCCCCCCCCCCCCCCCC(=O)O)ccc1O |
| InChI | InChI=1S/C26H40O6/c1-31-24-21-22(16-18-23(24)27)17-19-26(30)32-20-14-12-10-8-6-4-2-3-5-7-9-11-13-15-25(28)29/h16-19,21,27H,2-15,20H2,1H3,(H,28,29)/b19-17+ |
| InChIKey | DCZDUZNVOVFUCD-HTXNQAPBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 16-feruloyloxypalmitic acid (CHEBI:55330) has functional parent trans-ferulic acid (CHEBI:17620) |
| 16-feruloyloxypalmitic acid (CHEBI:55330) is a monocarboxylic acid (CHEBI:25384) |
| 16-feruloyloxypalmitic acid (CHEBI:55330) is conjugate acid of 16-feruloyloxypalmitate (CHEBI:55331) |
| Incoming Relation(s) |
| 16-feruloyloxypalmitate (CHEBI:55331) is conjugate base of 16-feruloyloxypalmitic acid (CHEBI:55330) |
| IUPAC Name |
|---|
| 16-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}hexadecanoic acid |
| Synonym | Source |
|---|---|
| 16-Feruloyloxypalmitic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18217 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5630504 | Beilstein |
| Beilstein:6824517 | Beilstein |