EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27NO3 |
| Net Charge | 0 |
| Average Mass | 353.462 |
| Monoisotopic Mass | 353.19909 |
| SMILES | CCCCc1ccc(CCNC(=O)/C=C/c2ccc(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-3-4-5-17-6-8-18(9-7-17)14-15-23-22(25)13-11-19-10-12-20(24)21(16-19)26-2/h6-13,16,24H,3-5,14-15H2,1-2H3,(H,23,25)/b13-11+ |
| InChIKey | QHMUIOCUPBCVFT-ACCUITESSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cuscuta reflexa (ncbitaxon:4129) | whole plant (BTO:0001461) | PubMed (11824569) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cuscuta propenamide 2 (CHEBI:65701) has functional parent trans-ferulic acid (CHEBI:17620) |
| Cuscuta propenamide 2 (CHEBI:65701) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| Cuscuta propenamide 2 (CHEBI:65701) has role plant metabolite (CHEBI:76924) |
| Cuscuta propenamide 2 (CHEBI:65701) is a enamide (CHEBI:51751) |
| Cuscuta propenamide 2 (CHEBI:65701) is a guaiacols (CHEBI:134251) |
| Cuscuta propenamide 2 (CHEBI:65701) is a secondary carboxamide (CHEBI:140325) |
| Synonyms | Source |
|---|---|
| (2E)-N-[2-(4-butylphenyl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide | ChEBI |
| 7'-(4'-hydroxy,3'-methoxyphenyl)-N-[(4-butylphenyl)ethyl]propenamide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9151874 | Reaxys |
| Citations |
|---|