EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H26O12 |
| Net Charge | 0 |
| Average Mass | 530.482 |
| Monoisotopic Mass | 530.14243 |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2C[C@@](OC(=O)/C=C/c3ccc(O)c(O)c3)(C(=O)O)C[C@@H](O)[C@@H]2O)ccc1O |
| InChI | InChI=1S/C26H26O12/c1-36-20-11-15(3-7-17(20)28)4-8-22(31)37-21-13-26(25(34)35,12-19(30)24(21)33)38-23(32)9-5-14-2-6-16(27)18(29)10-14/h2-11,19,21,24,27-30,33H,12-13H2,1H3,(H,34,35)/b8-4+,9-5+/t19-,21-,24+,26-/m1/s1 |
| InChIKey | DJXURFUTIYZESV-BQYLRUKMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phyllanthus niruri (ncbitaxon:296034) | - | MetaboLights (MTBLS224) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-caffeoyl-5-feruloylquinic acid (CHEBI:88343) has functional parent (−)-quinic acid (CHEBI:17521) |
| 1-caffeoyl-5-feruloylquinic acid (CHEBI:88343) has functional parent trans-caffeic acid (CHEBI:16433) |
| 1-caffeoyl-5-feruloylquinic acid (CHEBI:88343) has functional parent trans-ferulic acid (CHEBI:17620) |
| 1-caffeoyl-5-feruloylquinic acid (CHEBI:88343) is a polyphenol (CHEBI:26195) |
| 1-caffeoyl-5-feruloylquinic acid (CHEBI:88343) is a quinic acid (CHEBI:26493) |
| IUPAC Name |
|---|
| (1R,3R,4S,5R)-1-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy}-3,4-dihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid |
| Synonym | Source |
|---|---|
| 1-O-caffeoyl-5-O-feruloylquinic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041642 | HMDB |