EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:149477 - 1-feruloyl-sn-glycerol
| Formula | C13H16O6 |
| Net Charge | 0 |
| Average Mass | 268.265 |
| Monoisotopic Mass | 268.09469 |
| SMILES | COc1cc(/C=C/C(=O)OCC(O)CO)ccc1O |
| InChI | InChI=1S/C13H16O6/c1-18-12-6-9(2-4-11(12)16)3-5-13(17)19-8-10(15)7-14/h2-6,10,14-16H,7-8H2,1H3/b5-3+ |
| InChIKey | QXRAHTFDPBQKIM-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Populus tremula x Populus tremuloides (ncbitaxon:47664) | xylem (BTO:0001468) | MetaboLights (MTBLS628) | |
| Dioscorea alata (ncbitaxon:55571) | - | PubMed (17685543) | Strain: Cv. Tainung No. 2 |
| Lilium lancifolium (ncbitaxon:79002) | bulb (BTO:0000159) | DOI (10.1016/j.foodchem.2011.09.112) | |
| Smilax scobinicaulis (ncbitaxon:1080332) | - | PubMed (23947131) |
| Roles Classification |
|---|
| Chemical Roles: | ultraviolet filter A photochemical role realized in the absorption of ultraviolet light, for example to protect skin cells from damage. antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) has functional parent trans-ferulic acid (CHEBI:17620) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) has functional parent glycerol (CHEBI:17754) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) has role antioxidant (CHEBI:22586) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) has role plant metabolite (CHEBI:76924) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) has role ultraviolet filter (CHEBI:73335) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) is a 1-monoglyceride (CHEBI:35759) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) is a aromatic ether (CHEBI:35618) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) is a enoate ester (CHEBI:51702) |
| 1-feruloyl-sn-glycerol (CHEBI:149477) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 2,3-dihydroxypropyl (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| 1-feruloylglycerol | ChEBI |
| feruloyl-sn-glycerol | ChEBI |
| feruloylglycerol | ChEBI |
| 1-feruloyl-sn-glycerol | ChEBI |
| 1-O-feruloylglycerol | ChEBI |
| feruloyl glycerol | ChEBI |
| Citations |
|---|