EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:132257 - (2S,3R)-glycosmisic acid
| Formula | C20H20O7 |
| Net Charge | 0 |
| Average Mass | 372.373 |
| Monoisotopic Mass | 372.12090 |
| SMILES | COc1cc([C@H]2Oc3c(OC)cc(/C=C/C(=O)O)cc3[C@@H]2CO)ccc1O |
| InChI | InChI=1S/C20H20O7/c1-25-16-9-12(4-5-15(16)22)19-14(10-21)13-7-11(3-6-18(23)24)8-17(26-2)20(13)27-19/h3-9,14,19,21-22H,10H2,1-2H3,(H,23,24)/b6-3+/t14-,19+/m0/s1 |
| InChIKey | FHYQIQMSODIFCP-ZMOFONSMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sphingobium sp. (ncbitaxon:627192) | - | PubMed (26362985) | Strain: SYK-6 |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3R)-glycosmisic acid (CHEBI:132257) has functional parent trans-ferulic acid (CHEBI:17620) |
| (2S,3R)-glycosmisic acid (CHEBI:132257) has role plant metabolite (CHEBI:76924) |
| (2S,3R)-glycosmisic acid (CHEBI:132257) is a glycosmisic acid (CHEBI:91209) |
| (2S,3R)-glycosmisic acid (CHEBI:132257) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| (2S,3R)-glycosmisic acid (CHEBI:132257) is conjugate acid of ent-glycosmisate (CHEBI:131937) |
| (2S,3R)-glycosmisic acid (CHEBI:132257) is enantiomer of (2R,3S)-glycosmisic acid (CHEBI:132245) |
| Incoming Relation(s) |
| ent-glycosmisate (CHEBI:131937) is conjugate base of (2S,3R)-glycosmisic acid (CHEBI:132257) |
| (2R,3S)-glycosmisic acid (CHEBI:132245) is enantiomer of (2S,3R)-glycosmisic acid (CHEBI:132257) |
| IUPAC Name |
|---|
| (2E)-3-[(2S,3R)-2-(4-hydroxy-3-methoxyphenyl)-3-(hydroxymethyl)-7-methoxy-2,3-dihydro-1-benzofuran-5-yl]prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| (+)-DCA C | MetaCyc |
| (+)-dehydrodiconiferyl acid | MetaCyc |
| ent-spicatolignan B | ChEBI |
| ent-glycosmisic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-18963 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7663833 | Reaxys |
| Citations |
|---|