EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H14O9 |
| Net Charge | 0 |
| Average Mass | 326.257 |
| Monoisotopic Mass | 326.06378 |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H](C(=O)O)[C@@H](O)C(=O)O)ccc1O |
| InChI | InChI=1S/C14H14O9/c1-22-9-6-7(2-4-8(9)15)3-5-10(16)23-12(14(20)21)11(17)13(18)19/h2-6,11-12,15,17H,1H3,(H,18,19)(H,20,21)/b5-3+/t11-,12-/m1/s1 |
| InChIKey | XIWXUSFCUBAMFH-WEPHUFDCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R,3R)-trans-fertaric acid (CHEBI:76116) has functional parent trans-ferulic acid (CHEBI:17620) |
| (2R,3R)-trans-fertaric acid (CHEBI:76116) has functional parent L-tartaric acid (CHEBI:15671) |
| (2R,3R)-trans-fertaric acid (CHEBI:76116) has role metabolite (CHEBI:25212) |
| (2R,3R)-trans-fertaric acid (CHEBI:76116) is a fertaric acid (CHEBI:91032) |
| (2R,3R)-trans-fertaric acid (CHEBI:76116) is enantiomer of (2S,3S)-trans-fertaric acid (CHEBI:76120) |
| Incoming Relation(s) |
| (2S,3S)-trans-fertaric acid (CHEBI:76120) is enantiomer of (2R,3R)-trans-fertaric acid (CHEBI:76116) |
| IUPAC Name |
|---|
| (2R,3R)-2-hydroxy-3-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}butanedioic acid |
| Synonym | Source |
|---|---|
| trans-fertaric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22563905 | Reaxys |