EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O9 |
| Net Charge | 0 |
| Average Mass | 356.327 |
| Monoisotopic Mass | 356.11073 |
| SMILES | COc1ccc(/C=C/C(=O)O)cc1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C16H20O9/c1-23-9-4-2-8(3-5-12(18)19)6-10(9)24-16-15(22)14(21)13(20)11(7-17)25-16/h2-6,11,13-17,20-22H,7H2,1H3,(H,18,19)/b5-3+ |
| InChIKey | LOPCJHUBECHTEA-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nicotiana tabacum (ncbitaxon:4097) | cell suspension culture (BTO:0000221) | PubMed (29187153) | |
| Brassica oleracea (ncbitaxon:3712) | leaf (BTO:0000713) | PubMed (26616923) | |
| Solanum lycopersicum (ncbitaxon:4081) | - | PubMed (30158424) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| feruloylglycoside (CHEBI:142427) has functional parent trans-ferulic acid (CHEBI:17620) |
| feruloylglycoside (CHEBI:142427) is a glycoside (CHEBI:24400) |
| feruloylglycoside (CHEBI:142427) is a hydroxycinnamic acid (CHEBI:24689) |
| Citations |
|---|