EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O4 |
| Net Charge | 0 |
| Average Mass | 208.213 |
| Monoisotopic Mass | 208.07356 |
| SMILES | COC(=O)/C=C/c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C11H12O4/c1-14-10-7-8(3-5-9(10)12)4-6-11(13)15-2/h3-7,12H,1-2H3/b6-4+ |
| InChIKey | AUJXJFHANFIVKH-GQCTYLIASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-methylferulate (CHEBI:67379) has functional parent trans-ferulic acid (CHEBI:17620) |
| trans-methylferulate (CHEBI:67379) has role plant metabolite (CHEBI:76924) |
| trans-methylferulate (CHEBI:67379) is a cinnamate ester (CHEBI:36087) |
| trans-methylferulate (CHEBI:67379) is a guaiacols (CHEBI:134251) |
| trans-methylferulate (CHEBI:67379) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| 3-(4-hydroxy-3-methoxyphenyl)-2-propenoic acid methyl ester | ChemIDplus |
| 4-hydroxy-3-methoxy-cinnamic acid methyl ester | ChemIDplus |
| methyl (2E)-3-(4-hydroxy-3-methoxyphenyl)acrylate | ChEBI |
| Methyl ferulate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2731141 | Reaxys |
| CAS:2309-07-1 | ChemIDplus |
| Citations |
|---|