EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75544 - feruloylagmatine
| Formula | C15H22N4O3 |
| Net Charge | 0 |
| Average Mass | 306.366 |
| Monoisotopic Mass | 306.16919 |
| SMILES | COc1cc(/C=C/C(=O)NCCCCNC(=N)N)ccc1O |
| InChI | InChI=1S/C15H22N4O3/c1-22-13-10-11(4-6-12(13)20)5-7-14(21)18-8-2-3-9-19-15(16)17/h4-7,10,20H,2-3,8-9H2,1H3,(H,18,21)(H4,16,17,19)/b7-5+ |
| InChIKey | UBMDAKWARMURDL-FNORWQNLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | leaf (BTO:0000713) | PubMed (19521717) | |
| Corydalis saxicola (ncbitaxon:282776) | leaf (BTO:0000713) | PubMed (18649321) | |
| Hordeum vulgare (ncbitaxon:4513) | - | PubMed (18270436) | |
| Triticum aestivum (ncbitaxon:4565) | - | PubMed (10993146) |
| Roles Classification |
|---|
| Biological Roles: | EC 5.99.1.2 (DNA topoisomerase) inhibitor A topoisomerase inhibitor that inhibits the bacterial enzymes of the DNA topoisomerases, Type I class (EC 5.99.1.2) that catalyze ATP-independent breakage of one of the two strands of DNA, passage of the unbroken strand through the break, and rejoining of the broken strand. These bacterial enzymes reduce the topological stress in the DNA structure by relaxing negatively, but not positively, supercoiled DNA. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| feruloylagmatine (CHEBI:75544) has functional parent trans-ferulic acid (CHEBI:17620) |
| feruloylagmatine (CHEBI:75544) has functional parent agmatine (CHEBI:17431) |
| feruloylagmatine (CHEBI:75544) has role antifungal agent (CHEBI:35718) |
| feruloylagmatine (CHEBI:75544) has role EC 5.99.1.2 (DNA topoisomerase) inhibitor (CHEBI:50276) |
| feruloylagmatine (CHEBI:75544) has role plant metabolite (CHEBI:76924) |
| feruloylagmatine (CHEBI:75544) is a 4-hydroxy-3-methoxycinnamoylagmatine (CHEBI:86091) |
| feruloylagmatine (CHEBI:75544) is a alkaloid (CHEBI:22315) |
| Incoming Relation(s) |
| hordatine B (CHEBI:5763) has functional parent feruloylagmatine (CHEBI:75544) |
| IUPAC Name |
|---|
| (2E)-N-(4-carbamimidamidobutyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| Synonyms | Source |
|---|---|
| 1-(trans-4'-hydroxy-3'-methoxycinnamoylamino)-4-guanidinobutane | ChEBI |
| N1-trans-Feruloylagmatine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C18325 | KEGG COMPOUND |
| CPD-12236 | MetaCyc |
| HMDB0037107 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7650492 | Reaxys |
| Citations |
|---|