EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O9 |
| Net Charge | 0 |
| Average Mass | 356.327 |
| Monoisotopic Mass | 356.11073 |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)ccc1O |
| InChI | InChI=1S/C16H20O9/c1-23-10-6-8(2-4-9(10)18)3-5-12(19)25-16-15(22)14(21)13(20)11(7-17)24-16/h2-6,11,13-18,20-22H,7H2,1H3/b5-3+/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | JWRQVQWBNRGGPK-PMQCXRHVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Capsicum annuum (ncbitaxon:4072) | fruit (BTO:0000486) | PubMed (12895536) | Strain: var. Bronowicka Ostra |
| Fragaria x ananassa (ncbitaxon:3747) | - | PubMed (12060275) | Isolated from a callus culture |
| Luffa aegyptiaca (ncbitaxon:3670) | fruit (BTO:0000486) | PubMed (16756345) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-feruloyl-β-D-glucose (CHEBI:81321) has functional parent trans-ferulic acid (CHEBI:17620) |
| 1-O-feruloyl-β-D-glucose (CHEBI:81321) has role antioxidant (CHEBI:22586) |
| 1-O-feruloyl-β-D-glucose (CHEBI:81321) has role plant metabolite (CHEBI:76924) |
| 1-O-feruloyl-β-D-glucose (CHEBI:81321) is a aromatic ether (CHEBI:35618) |
| 1-O-feruloyl-β-D-glucose (CHEBI:81321) is a cinnamate ester (CHEBI:36087) |
| 1-O-feruloyl-β-D-glucose (CHEBI:81321) is a phenols (CHEBI:33853) |
| 1-O-feruloyl-β-D-glucose (CHEBI:81321) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 1-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 1-O-(E)-p-feruloyl-β-D-glucopyranose | ChEBI |
| 1-O-(E)-feruloyl-β-D-glucose | ChEBI |
| 1-O-trans-feruloyl-β-D-glucopyranoside | ChEBI |
| 1-Feruloyl-D-glucose | KEGG COMPOUND |
| ferulic acid β-D-glucopyranosyl ester | ChEBI |
| (E)-1-O-feruloyl-β-D-glucopyranose | ChEBI |
| UniProt Name | Source |
|---|---|
| 1-O-[(E)-feruloyl]-β-D-glucose | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C17759 | KEGG COMPOUND |
| CPD-15281 | MetaCyc |
| FDB015907 | FooDB |
| HMDB0036938 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1297206 | Reaxys |
| Citations |
|---|