EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N2O4 |
| Net Charge | 0 |
| Average Mass | 352.390 |
| Monoisotopic Mass | 352.14231 |
| SMILES | COc1cc(/C=C/C(=O)NCCc2cnc3ccc(O)cc23)ccc1O |
| InChI | InChI=1S/C20H20N2O4/c1-26-19-10-13(2-6-18(19)24)3-7-20(25)21-9-8-14-12-22-17-5-4-15(23)11-16(14)17/h2-7,10-12,22-24H,8-9H2,1H3,(H,21,25)/b7-3+ |
| InChIKey | WGHKJYWENWLOMY-XVNBXDOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Centella asiatica (ncbitaxon:48106) | - | MetaboLights (MTBLS175) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-feruloylserotonin (CHEBI:85158) has functional parent trans-ferulic acid (CHEBI:17620) |
| N-feruloylserotonin (CHEBI:85158) has role plant metabolite (CHEBI:76924) |
| N-feruloylserotonin (CHEBI:85158) is a aromatic ether (CHEBI:35618) |
| N-feruloylserotonin (CHEBI:85158) is a cinnamamides (CHEBI:23247) |
| N-feruloylserotonin (CHEBI:85158) is a hydroxyindoles (CHEBI:84729) |
| N-feruloylserotonin (CHEBI:85158) is a phenols (CHEBI:33853) |
| N-feruloylserotonin (CHEBI:85158) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2E)-N-[2-(5-hydroxy-1H-indol-3-yl)ethyl]-3-(4-hydroxy-3-methoxyphenyl)prop-2-enamide |
| Synonym | Source |
|---|---|
| Moschamine | HMDB |
| Manual Xrefs | Databases |
|---|---|
| CPD-8935 | MetaCyc |
| HMDB0032759 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:443718 | Reaxys |