EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:69436 - 3-O-feruloylcycloartenol
| Formula | C40H58O4 |
| Net Charge | 0 |
| Average Mass | 602.900 |
| Monoisotopic Mass | 602.43351 |
| SMILES | [H][C@@]12CC[C@@]3([H])C(C)(C)[C@@H](OC(=O)/C=C/c4ccc(O)c(OC)c4)CC[C@@]34C[C@@]14CC[C@]1(C)[C@@H](C(C)CCC=C(C)C)CC[C@@]21C |
| InChI | InChI=1S/C40H58O4/c1-26(2)10-9-11-27(3)29-18-20-38(7)33-16-15-32-36(4,5)34(19-21-39(32)25-40(33,39)23-22-37(29,38)6)44-35(42)17-13-28-12-14-30(41)31(24-28)43-8/h10,12-14,17,24,27,29,32-34,41H,9,11,15-16,18-23,25H2,1-8H3/b17-13+/t27?,29-,32+,33+,34+,37-,38+,39-,40+/m1/s1 |
| InChIKey | FODTZLFLDFKIQH-CYEBEXFSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordyceps sinensis (ncbitaxon:72228) | mycelium (BTO:0001436) | PubMed (21848266) | Ethanolic extract of dried mycelia |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. central nervous system drug A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-feruloylcycloartenol (CHEBI:69436) has functional parent trans-ferulic acid (CHEBI:17620) |
| 3-O-feruloylcycloartenol (CHEBI:69436) has functional parent cycloartenol (CHEBI:17030) |
| 3-O-feruloylcycloartenol (CHEBI:69436) has role antineoplastic agent (CHEBI:35610) |
| 3-O-feruloylcycloartenol (CHEBI:69436) has role central nervous system drug (CHEBI:35470) |
| 3-O-feruloylcycloartenol (CHEBI:69436) has role fungal metabolite (CHEBI:76946) |
| 3-O-feruloylcycloartenol (CHEBI:69436) has role plant metabolite (CHEBI:76924) |
| 3-O-feruloylcycloartenol (CHEBI:69436) is a cinnamate ester (CHEBI:36087) |
| 3-O-feruloylcycloartenol (CHEBI:69436) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| 9β,19-cyclolanost-24-en-3β-yl (2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| cycloartenol ferulic acid ester | ChEBI |
| 3β-(4-hydroxy-3-methoxy-trans-cinnamoyloxy)-9β,19-cyclo-lanost-24-ene | ChEBI |
| cycloartenol ferulate | ChEBI |
| (3β)-9,19-cyclolanost-24-en-3-yl 4-hydroxy-3-methoxycinnamate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3188008 | Reaxys |
| CAS:21238-33-5 | ChemIDplus |
| Citations |
|---|