EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H12O5 |
| Net Charge | 0 |
| Average Mass | 236.223 |
| Monoisotopic Mass | 236.06847 |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1OC(C)=O |
| InChI | InChI=1S/C12H12O5/c1-8(13)17-10-5-3-9(4-6-12(14)15)7-11(10)16-2/h3-7H,1-2H3,(H,14,15)/b6-4+ |
| InChIKey | IHKNVZISLLDMOR-GQCTYLIASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-acetylferulic acid (CHEBI:86582) has functional parent trans-ferulic acid (CHEBI:17620) |
| O-acetylferulic acid (CHEBI:86582) is a cinnamic acids (CHEBI:23252) |
| O-acetylferulic acid (CHEBI:86582) is a monomethoxybenzene (CHEBI:25235) |
| O-acetylferulic acid (CHEBI:86582) is a phenyl acetates (CHEBI:140310) |
| IUPAC Name |
|---|
| (2E)-3-[4-(acetyloxy)-3-methoxyphenyl]prop-2-enoic acid |
| Synonyms | Source |
|---|---|
| acetylated ferulic acid | ChEBI |
| trans-3-[4-acetyloxy-3-methoxyphenyl]-2-propenoic acid | ChEBI |
| 3-Methoxy-4-acetoxycinnamic acid | ChemIDplus |
| Acetylferulic acid | ChemIDplus |
| 4-Acetoxy-3-methoxycinnamic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2218027 | Reaxys |
| CAS:2596-47-6 | ChemIDplus |