EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H20O9 |
| Net Charge | 0 |
| Average Mass | 368.338 |
| Monoisotopic Mass | 368.11073 |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2C[C@](O)(C(=O)O)C[C@@H](O)[C@H]2O)ccc1O |
| InChI | InChI=1S/C17H20O9/c1-25-12-6-9(2-4-10(12)18)3-5-14(20)26-13-8-17(24,16(22)23)7-11(19)15(13)21/h2-6,11,13,15,18-19,21,24H,7-8H2,1H3,(H,22,23)/b5-3+/t11-,13-,15-,17+/m1/s1 |
| InChIKey | RAGZUCNPTLULOL-KJJWLSQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ilex paraguariensis (ncbitaxon:185542) | - | PubMed (25955847) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-feruloyl-D-quinic acid (CHEBI:86388) has functional parent (−)-quinic acid (CHEBI:17521) |
| 3-O-feruloyl-D-quinic acid (CHEBI:86388) has functional parent trans-ferulic acid (CHEBI:17620) |
| 3-O-feruloyl-D-quinic acid (CHEBI:86388) has role plant metabolite (CHEBI:76924) |
| 3-O-feruloyl-D-quinic acid (CHEBI:86388) is a enoate ester (CHEBI:51702) |
| 3-O-feruloyl-D-quinic acid (CHEBI:86388) is a quinic acid (CHEBI:26493) |
| IUPAC Name |
|---|
| (1S,3R,4R,5R)-1,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxy}cyclohexane-1-carboxylic acid |