EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H15NO6 |
| Net Charge | 0 |
| Average Mass | 329.308 |
| Monoisotopic Mass | 329.08994 |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(O)cc2C(=O)O)ccc1O |
| InChI | InChI=1S/C17H15NO6/c1-24-15-8-10(2-6-14(15)20)3-7-16(21)18-13-5-4-11(19)9-12(13)17(22)23/h2-9,19-20H,1H3,(H,18,21)(H,22,23)/b7-3+ |
| InChIKey | JXFZHMCSCYADIX-XVNBXDOJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Avena sativa (ncbitaxon:4498) | |||
| seed (BTO:0001226) | PubMed (10739096) | ||
| leaf (BTO:0000713) | DOI (10.1111/j.1365-313X.2004.02163.x) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| avenanthramide B (CHEBI:167489) has functional parent trans-ferulic acid (CHEBI:17620) |
| avenanthramide B (CHEBI:167489) has role antineoplastic agent (CHEBI:35610) |
| avenanthramide B (CHEBI:167489) has role apoptosis inducer (CHEBI:68495) |
| avenanthramide B (CHEBI:167489) has role phytoalexin (CHEBI:26115) |
| avenanthramide B (CHEBI:167489) is a amidobenzoic acid (CHEBI:48470) |
| avenanthramide B (CHEBI:167489) is a cinnamamides (CHEBI:23247) |
| avenanthramide B (CHEBI:167489) is a monohydroxybenzoic acid (CHEBI:25389) |
| avenanthramide B (CHEBI:167489) is a monomethoxybenzene (CHEBI:25235) |
| avenanthramide B (CHEBI:167489) is a phenols (CHEBI:33853) |
| avenanthramide B (CHEBI:167489) is a secondary carboxamide (CHEBI:140325) |
| avenanthramide B (CHEBI:167489) is conjugate acid of avenanthramide B(1−) (CHEBI:167465) |
| Incoming Relation(s) |
| avenanthramide B(1−) (CHEBI:167465) is conjugate base of avenanthramide B (CHEBI:167489) |
| IUPAC Name |
|---|
| 5-hydroxy-2-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]amino}benzoic acid |
| Synonyms | Source |
|---|---|
| 5-hydroxy-2-{[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propenyl]amino}benzoic acid | ChEBI |
| avenanthramide 1 | ChemIDplus |
| avenanthramide 2F | ChemIDplus |
| avenanthramide BF | ChemIDplus |
| N-[4'-hydroxy-3'-methoxy-(E)-cinnamoyl]-5-hydroxyanthranilic acid | ChEBI |
| N-feruloyl-5-hydroxyanthranilic acid | FooDB |
| Manual Xrefs | Databases |
|---|---|
| 8263492 | ChemSpider |
| FDB000285 | FooDB |
| HMDB0038575 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3625397 | Reaxys |
| CAS:108605-69-2 | ChemIDplus |
| Citations |
|---|