EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10O7S |
| Net Charge | 0 |
| Average Mass | 274.250 |
| Monoisotopic Mass | 274.01472 |
| SMILES | COc1cc(/C=C/C(=O)O)ccc1OS(=O)(=O)O |
| InChI | InChI=1S/C10H10O7S/c1-16-9-6-7(3-5-10(11)12)2-4-8(9)17-18(13,14)15/h2-6H,1H3,(H,11,12)(H,13,14,15)/b5-3+ |
| InChIKey | PZPATWACAAOHTJ-HWKANZROSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (25787755) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (24503197) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ferulic acid 4-sulfate (CHEBI:133508) has functional parent trans-ferulic acid (CHEBI:17620) |
| ferulic acid 4-sulfate (CHEBI:133508) has role human xenobiotic metabolite (CHEBI:76967) |
| ferulic acid 4-sulfate (CHEBI:133508) has role rat metabolite (CHEBI:86264) |
| ferulic acid 4-sulfate (CHEBI:133508) is a aryl sulfate (CHEBI:37919) |
| ferulic acid 4-sulfate (CHEBI:133508) is a cinnamic acids (CHEBI:23252) |
| ferulic acid 4-sulfate (CHEBI:133508) is a monomethoxybenzene (CHEBI:25235) |
| ferulic acid 4-sulfate (CHEBI:133508) is conjugate acid of ferulic acid 4-sulfate anion (CHEBI:133512) |
| Incoming Relation(s) |
| ferulic acid 4-sulfate anion (CHEBI:133512) is conjugate base of ferulic acid 4-sulfate (CHEBI:133508) |
| IUPAC Name |
|---|
| (2E)-3-[3-methoxy-4-(sulfooxy)phenyl]prop-2-enoic acid |
| Synonym | Source |
|---|---|
| ferulic acid sulfate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029200 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6605856 | Reaxys |
| CAS:86321-29-1 | ChemIDplus |
| Citations |
|---|