EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO5 |
| Net Charge | 0 |
| Average Mass | 343.379 |
| Monoisotopic Mass | 343.14197 |
| SMILES | COc1ccc(CCNC(=O)/C=C/c2ccc(O)c(OC)c2)cc1O |
| InChI | InChI=1S/C19H21NO5/c1-24-17-7-4-14(11-16(17)22)9-10-20-19(23)8-5-13-3-6-15(21)18(12-13)25-2/h3-8,11-12,21-22H,9-10H2,1-2H3,(H,20,23)/b8-5+ |
| InChIKey | ACSWAJLDOHJFNA-VMPITWQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pisonia aculeata (ncbitaxon:363212) | |||
| root (BTO:0001188) | PubMed (21542597) | Cold methanolic extract of dried stems and roots | |
| stem (BTO:0001300) | PubMed (21542597) | Cold methanolic extract of dried stems and roots |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-trans-feruloyl-4'-O-methyldopamine (CHEBI:67378) has functional parent trans-ferulic acid (CHEBI:17620) |
| N-trans-feruloyl-4'-O-methyldopamine (CHEBI:67378) has role plant metabolite (CHEBI:76924) |
| N-trans-feruloyl-4'-O-methyldopamine (CHEBI:67378) is a cinnamamides (CHEBI:23247) |
| N-trans-feruloyl-4'-O-methyldopamine (CHEBI:67378) is a guaiacols (CHEBI:134251) |
| N-trans-feruloyl-4'-O-methyldopamine (CHEBI:67378) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxy-3-methoxyphenyl)-N-[2-(3-hydroxy-4-methoxyphenyl)ethyl]prop-2-enamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6982431 | Reaxys |
| Citations |
|---|