EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9N3O2 |
| Net Charge | 0 |
| Average Mass | 155.157 |
| Monoisotopic Mass | 155.06948 |
| SMILES | N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1 |
| InChIKey | HNDVDQJCIGZPNO-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chlamydomonas reinhardtii (ncbitaxon:3055) | - | PubMed (25515814) | |
| Escherichia coli (ncbitaxon:562) | |||
| - | PubMed (8852895) | ||
| - | PubMed (21988831) | ||
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Saccharomyces cerevisiae (ncbitaxon:4932) | |||
| - | PubMed (24678285) | Source: yeast.sf.net | |
| - | PubMed (8852895) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). micronutrient Any nutrient required in small quantities by organisms throughout their life in order to orchestrate a range of physiological functions. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-histidine (CHEBI:15971) has role Escherichia coli metabolite (CHEBI:76971) |
| L-histidine (CHEBI:15971) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| L-histidine (CHEBI:15971) has role algal metabolite (CHEBI:84735) |
| L-histidine (CHEBI:15971) has role human metabolite (CHEBI:77746) |
| L-histidine (CHEBI:15971) has role micronutrient (CHEBI:27027) |
| L-histidine (CHEBI:15971) has role mouse metabolite (CHEBI:75771) |
| L-histidine (CHEBI:15971) has role nutraceutical (CHEBI:50733) |
| L-histidine (CHEBI:15971) is a L-α-amino acid (CHEBI:15705) |
| L-histidine (CHEBI:15971) is a histidine (CHEBI:27570) |
| L-histidine (CHEBI:15971) is a proteinogenic amino acid (CHEBI:83813) |
| L-histidine (CHEBI:15971) is conjugate acid of L-histidinate(1−) (CHEBI:32510) |
| L-histidine (CHEBI:15971) is conjugate base of L-histidinium(1+) (CHEBI:32513) |
| L-histidine (CHEBI:15971) is enantiomer of D-histidine (CHEBI:27947) |
| L-histidine (CHEBI:15971) is tautomer of L-histidine zwitterion (CHEBI:57595) |
| Incoming Relation(s) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) has functional parent L-histidine (CHEBI:15971) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine (CHEBI:83292) has functional parent L-histidine (CHEBI:15971) |
| L-histidine derivative (CHEBI:84076) has functional parent L-histidine (CHEBI:15971) |
| Ala-Gly-His (CHEBI:73348) has functional parent L-histidine (CHEBI:15971) |
| Ala-Leu-Leu-His (CHEBI:73365) has functional parent L-histidine (CHEBI:15971) |
| Ala-Val-Asp-His (CHEBI:73383) has functional parent L-histidine (CHEBI:15971) |
| Asn-Gly-Pro-His (CHEBI:176851) has functional parent L-histidine (CHEBI:15971) |
| Asn-His (CHEBI:73424) has functional parent L-histidine (CHEBI:15971) |
| Asn-Lys-His-His (CHEBI:176852) has functional parent L-histidine (CHEBI:15971) |
| Asn-Trp-Cys-His (CHEBI:73415) has functional parent L-histidine (CHEBI:15971) |
| Asp-His (CHEBI:73451) has functional parent L-histidine (CHEBI:15971) |
| cyclo(L-His-L-Pro) (CHEBI:90039) has functional parent L-histidine (CHEBI:15971) |
| Cys-Cys-His-His (CHEBI:73456) has functional parent L-histidine (CHEBI:15971) |
| Cys-Met-Phe-His (CHEBI:138508) has functional parent L-histidine (CHEBI:15971) |
| Gly-His (CHEBI:73515) has functional parent L-histidine (CHEBI:15971) |
| Hexa-His (CHEBI:234280) has functional parent L-histidine (CHEBI:15971) |
| His-His (CHEBI:74051) has functional parent L-histidine (CHEBI:15971) |
| His-Ile (CHEBI:141437) has functional parent L-histidine (CHEBI:15971) |
| His-Phe (CHEBI:141438) has functional parent L-histidine (CHEBI:15971) |
| Ile-His (CHEBI:73520) has functional parent L-histidine (CHEBI:15971) |
| Leu-Asn-His (CHEBI:73530) has functional parent L-histidine (CHEBI:15971) |
| Phe-His (CHEBI:73634) has functional parent L-histidine (CHEBI:15971) |
| Ser-His (CHEBI:73651) has functional parent L-histidine (CHEBI:15971) |
| Thr-Ala-His (CHEBI:73656) has functional parent L-histidine (CHEBI:15971) |
| Thr-His (CHEBI:73663) has functional parent L-histidine (CHEBI:15971) |
| Tyr-His (CHEBI:73695) has functional parent L-histidine (CHEBI:15971) |
| Val-His (CHEBI:73700) has functional parent L-histidine (CHEBI:15971) |
| α-methyl-L-histidine (CHEBI:189415) has functional parent L-histidine (CHEBI:15971) |
| L-histidinium(1+) (CHEBI:32513) is conjugate acid of L-histidine (CHEBI:15971) |
| L-histidinate(1−) (CHEBI:32510) is conjugate base of L-histidine (CHEBI:15971) |
| D-histidine (CHEBI:27947) is enantiomer of L-histidine (CHEBI:15971) |
| N2-L-histidino group (CHEBI:32515) is substituent group from L-histidine (CHEBI:15971) |
| Nπ-L-histidino group (CHEBI:32516) is substituent group from L-histidine (CHEBI:15971) |
| Nτ-L-histidino group (CHEBI:32517) is substituent group from L-histidine (CHEBI:15971) |
| L-histidine residue (CHEBI:29979) is substituent group from L-histidine (CHEBI:15971) |
| L-histidyl group (CHEBI:32514) is substituent group from L-histidine (CHEBI:15971) |
| L-histidine zwitterion (CHEBI:57595) is tautomer of L-histidine (CHEBI:15971) |
| IUPAC Names |
|---|
| (2S)-2-amino-3-(1H-imidazol-4-yl)propanoic acid |
| L-histidine |
| Synonyms | Source |
|---|---|
| H | ChEBI |
| His | ChEBI |
| HISTIDINE | PDBeChem |
| (S)-α-amino-1H-Imidazole-4-propanoic acid | NIST Chemistry WebBook |
| L-Histidine | KEGG COMPOUND |
| (S)-4-(2-Amino-2-carboxyethyl)imidazole | DrugBank |
| Manual Xrefs | Databases |
|---|---|
| C00001363 | KNApSAcK |
| C00135 | KEGG COMPOUND |
| D00032 | KEGG DRUG |
| DB00117 | DrugBank |
| ECMDB00177 | ECMDB |
| HIS | PDBeChem |
| HIS | MetaCyc |
| HMDB0000177 | HMDB |
| L-histidine | Wikipedia |
| YMDB00369 | YMDB |
| Citations |
|---|