EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27N5O7Se |
| Net Charge | 0 |
| Average Mass | 492.391 |
| Monoisotopic Mass | 493.10757 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cnc([Se]C[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O)n1)C(=O)[O-] |
| InChI | InChI=1S/C17H27N5O7Se/c1-22(2,3)12(16(28)29)6-9-7-19-17(20-9)30-8-11(15(26)27)21-13(23)5-4-10(18)14(24)25/h7,10-12H,4-6,8,18H2,1-3H3,(H4-,19,20,21,23,24,25,26,27,28,29)/t10-,11-,12-/m0/s1 |
| InChIKey | IHNYLIPKEWRBIH-SRVKXCTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine (CHEBI:83292) has functional parent L-histidine (CHEBI:15971) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine (CHEBI:83292) has role fungal metabolite (CHEBI:76946) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine (CHEBI:83292) is a ammonium betaine (CHEBI:35284) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine (CHEBI:83292) is a dipeptide (CHEBI:46761) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine (CHEBI:83292) is a sulfoxide (CHEBI:22063) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine (CHEBI:83292) is conjugate acid of Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine(1−) (CHEBI:82704) |
| Incoming Relation(s) |
| Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine(1−) (CHEBI:82704) is conjugate base of Nα-(L-γ-glutamyl)-hercynyl-L-selenocysteine (CHEBI:83292) |
| IUPAC Name |
|---|
| L-γ-glutamyl-3-({4-[(2S)-2-carboxylato-2-(trimethylazaniumyl)ethyl]-1H-imidazol-2-yl}selanyl)-L-alanine |