EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30N8O6S |
| Net Charge | 0 |
| Average Mass | 558.621 |
| Monoisotopic Mass | 558.20090 |
| SMILES | NC(=O)C[C@H](N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CS)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C24H30N8O6S/c25-15(7-20(26)33)21(34)30-17(5-12-8-28-16-4-2-1-3-14(12)16)22(35)32-19(10-39)23(36)31-18(24(37)38)6-13-9-27-11-29-13/h1-4,8-9,11,15,17-19,28,39H,5-7,10,25H2,(H2,26,33)(H,27,29)(H,30,34)(H,31,36)(H,32,35)(H,37,38)/t15-,17-,18-,19-/m0/s1 |
| InChIKey | OKWDNPXELOHZLD-WNHJNPCNSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Trp-Cys-His (CHEBI:73415) has functional parent L-asparagine (CHEBI:17196) |
| Asn-Trp-Cys-His (CHEBI:73415) has functional parent L-cysteine (CHEBI:17561) |
| Asn-Trp-Cys-His (CHEBI:73415) has functional parent L-histidine (CHEBI:15971) |
| Asn-Trp-Cys-His (CHEBI:73415) has functional parent L-tryptophan (CHEBI:16828) |
| Asn-Trp-Cys-His (CHEBI:73415) has role metabolite (CHEBI:25212) |
| Asn-Trp-Cys-His (CHEBI:73415) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-asparaginyl-L-tryptophyl-L-cysteinyl-L-histidine |
| Synonyms | Source |
|---|---|
| NWCH | ChEBI |
| L-Asn-L-Trp-L-Cys-L-His | ChEBI |
| N-W-C-H | ChEBI |