EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H27N5O8S |
| Net Charge | 0 |
| Average Mass | 461.497 |
| Monoisotopic Mass | 461.15803 |
| SMILES | C[N+](C)(C)[C@@H](Cc1cnc(S(=O)C[C@H](NC(=O)CC[C@H](N)C(=O)O)C(=O)O)n1)C(=O)[O-] |
| InChI | InChI=1S/C17H27N5O8S/c1-22(2,3)12(16(28)29)6-9-7-19-17(20-9)31(30)8-11(15(26)27)21-13(23)5-4-10(18)14(24)25/h7,10-12H,4-6,8,18H2,1-3H3,(H4-,19,20,21,23,24,25,26,27,28,29)/t10-,11-,12-,31?/m0/s1 |
| InChIKey | SJHLSLUUWIBQNS-TYLCEOGASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) has functional parent L-cysteine (CHEBI:17561) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) has functional parent L-histidine (CHEBI:15971) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) has role fungal metabolite (CHEBI:76946) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) is a ammonium betaine (CHEBI:35284) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) is a dipeptide (CHEBI:46761) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) is a sulfoxide (CHEBI:22063) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) is conjugate acid of Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide(1−) (CHEBI:82703) |
| Incoming Relation(s) |
| Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide(1−) (CHEBI:82703) is conjugate base of Nα-(L-γ-glutamyl)-hercynyl-L-cysteine sulfoxide (CHEBI:83290) |
| IUPAC Name |
|---|
| L-γ-glutamyl-3-({4-[(2S)-2-carboxylato-2-(trimethylazaniumyl)ethyl]-1H-imidazol-2-yl}sulfinyl)-L-alanine |
| Manual Xrefs | Databases |
|---|---|
| CPD-15279 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:24604970 | Reaxys |