EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12N4O3 |
| Net Charge | 0 |
| Average Mass | 212.209 |
| Monoisotopic Mass | 212.09094 |
| SMILES | NCC(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C8H12N4O3/c9-2-7(13)12-6(8(14)15)1-5-3-10-4-11-5/h3-4,6H,1-2,9H2,(H,10,11)(H,12,13)(H,14,15)/t6-/m0/s1 |
| InChIKey | YIWFXZNIBQBFHR-LURJTMIESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gly-His (CHEBI:73515) has functional parent L-histidine (CHEBI:15971) |
| Gly-His (CHEBI:73515) has functional parent glycine (CHEBI:15428) |
| Gly-His (CHEBI:73515) has role metabolite (CHEBI:25212) |
| Gly-His (CHEBI:73515) is a dipeptide (CHEBI:46761) |
| Gly-His (CHEBI:73515) is tautomer of Gly-His zwitterion (CHEBI:169956) |
| Incoming Relation(s) |
| Gly-His zwitterion (CHEBI:169956) is tautomer of Gly-His (CHEBI:73515) |
| IUPAC Name |
|---|
| glycyl-L-histidine |
| Synonyms | Source |
|---|---|
| (2S)-2-(2-aminoacetamido)-3-(1H-imidazol-5-yl)propanoic acid | IUPAC |
| G-H | ChEBI |
| GH | ChEBI |
| glycylhistidine | ChEBI |
| Gly-L-His | ChEBI |
| H-Gly-His-OH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 5385970 | ChemSpider |
| HMDB0028843 | HMDB |
| Citations |
|---|