EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26N8O5S2 |
| Net Charge | 0 |
| Average Mass | 498.591 |
| Monoisotopic Mass | 498.14676 |
| SMILES | N[C@@H](CS)C(=O)N[C@@H](CS)C(=O)N[C@@H](Cc1cncn1)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C18H26N8O5S2/c19-11(5-32)15(27)26-14(6-33)17(29)24-12(1-9-3-20-7-22-9)16(28)25-13(18(30)31)2-10-4-21-8-23-10/h3-4,7-8,11-14,32-33H,1-2,5-6,19H2,(H,20,22)(H,21,23)(H,24,29)(H,25,28)(H,26,27)(H,30,31)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | ZGRQPKYPJYNOKX-XUXIUFHCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cys-Cys-His-His (CHEBI:73456) has functional parent L-cysteine (CHEBI:17561) |
| Cys-Cys-His-His (CHEBI:73456) has functional parent L-histidine (CHEBI:15971) |
| Cys-Cys-His-His (CHEBI:73456) has role metabolite (CHEBI:25212) |
| Cys-Cys-His-His (CHEBI:73456) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-cysteinyl-L-cysteinyl-L-histidyl-L-histidine |
| Synonyms | Source |
|---|---|
| L-Cys-L-Cys-L-His-L-His | ChEBI |
| CCHH | ChEBI |
| C-C-H-H | ChEBI |