EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H17N5O4 |
| Net Charge | 0 |
| Average Mass | 283.288 |
| Monoisotopic Mass | 283.12805 |
| SMILES | C[C@H](N)C(=O)NCC(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C11H17N5O4/c1-6(12)10(18)14-4-9(17)16-8(11(19)20)2-7-3-13-5-15-7/h3,5-6,8H,2,4,12H2,1H3,(H,13,15)(H,14,18)(H,16,17)(H,19,20)/t6-,8-/m0/s1 |
| InChIKey | BTBUEVAGZCKULD-XPUUQOCRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Gly-His (CHEBI:73348) has functional parent L-alanine (CHEBI:16977) |
| Ala-Gly-His (CHEBI:73348) has functional parent L-histidine (CHEBI:15971) |
| Ala-Gly-His (CHEBI:73348) has functional parent glycine (CHEBI:15428) |
| Ala-Gly-His (CHEBI:73348) has role metabolite (CHEBI:25212) |
| Ala-Gly-His (CHEBI:73348) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-alanylglycyl-L-histidine |
| Synonyms | Source |
|---|---|
| A-G-H | ChEBI |
| AGH | ChEBI |
| L-Ala-Gly-L-His | ChEBI |