EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N4O5 |
| Net Charge | 0 |
| Average Mass | 270.245 |
| Monoisotopic Mass | 270.09642 |
| SMILES | N[C@@H](CC(=O)O)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C10H14N4O5/c11-6(2-8(15)16)9(17)14-7(10(18)19)1-5-3-12-4-13-5/h3-4,6-7H,1-2,11H2,(H,12,13)(H,14,17)(H,15,16)(H,18,19)/t6-,7-/m0/s1 |
| InChIKey | HSPSXROIMXIJQW-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asp-His (CHEBI:73451) has functional parent L-aspartic acid (CHEBI:17053) |
| Asp-His (CHEBI:73451) has functional parent L-histidine (CHEBI:15971) |
| Asp-His (CHEBI:73451) has role metabolite (CHEBI:25212) |
| Asp-His (CHEBI:73451) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-α-aspartyl-L-histidine |
| Synonyms | Source |
|---|---|
| DH | ChEBI |
| D-H | ChEBI |
| L-Asp-L-His | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028755 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8707749 | Reaxys |