EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N4O4 |
| Net Charge | 0 |
| Average Mass | 256.262 |
| Monoisotopic Mass | 256.11715 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C10H16N4O4/c1-5(15)8(11)9(16)14-7(10(17)18)2-6-3-12-4-13-6/h3-5,7-8,15H,2,11H2,1H3,(H,12,13)(H,14,16)(H,17,18)/t5-,7+,8+/m1/s1 |
| InChIKey | WXVIGTAUZBUDPZ-DTLFHODZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-His (CHEBI:73663) has functional parent L-histidine (CHEBI:15971) |
| Thr-His (CHEBI:73663) has functional parent L-threonine (CHEBI:16857) |
| Thr-His (CHEBI:73663) has role metabolite (CHEBI:25212) |
| Thr-His (CHEBI:73663) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-histidine |
| Synonyms | Source |
|---|---|
| L-Thr-L-His | ChEBI |
| T-H | ChEBI |
| TH | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029063 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8704532 | Reaxys |