EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9N3O2 |
| Net Charge | 0 |
| Average Mass | 155.157 |
| Monoisotopic Mass | 155.06948 |
| SMILES | [NH3+][C@@H](Cc1cncn1)C(=O)[O-] |
| InChI | InChI=1S/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1 |
| InChIKey | HNDVDQJCIGZPNO-YFKPBYRVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-histidine zwitterion (CHEBI:57595) is a amino-acid zwitterion (CHEBI:35238) |
| L-histidine zwitterion (CHEBI:57595) is a polar amino acid zwitterion (CHEBI:62031) |
| L-histidine zwitterion (CHEBI:57595) is tautomer of L-histidine (CHEBI:15971) |
| Incoming Relation(s) |
| S-(5-histidyl)cysteine sulfoxide dizwitterion (CHEBI:82728) has functional parent L-histidine zwitterion (CHEBI:57595) |
| ovothiol A zwitterion (CHEBI:82723) has functional parent L-histidine zwitterion (CHEBI:57595) |
| ovothiol B zwitterion (CHEBI:82724) has functional parent L-histidine zwitterion (CHEBI:57595) |
| ovothiol C zwitterion (CHEBI:82725) has functional parent L-histidine zwitterion (CHEBI:57595) |
| L-histidine (CHEBI:15971) is tautomer of L-histidine zwitterion (CHEBI:57595) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-(1H-imidazol-4-yl)propanoate |
| Synonym | Source |
|---|---|
| (2S)-2-ammonio-3-(1H-imidazol-4-yl)propanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| L-histidine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HIS | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Gmelin:663322 | Gmelin |